PAR2 (1-6) amide (human) (trifluoroacetate salt)

Description: PAR2 (1-6) amide is a synthetic peptide agonist of proteinase-activated receptor 2 (PAR2) that corresponds to residues 1-6 of the amino terminal tethered ligand sequence of human PAR2 and residues 37-42 of the full-length sequence.1It binds to NCTC 2544 cells expressing human PAR2 (Ki= 9.64 µM in a radioligand binding assay) and induces calcium mobilization in the same cells (EC50= 0.075 µM).2PAR2 (1-6) amide (100 µM) reduces colony formation of A549 lung cancer cells.1It induces superoxide production and degranulation in isolated human eosinophils when used at a concentration of 500 µM.3PAR2 (1-6) amide (5 µmol/kg) induces tear secretion in rats when used in combination with amastatin .4. Smiles: OC(=O)C(F)(F)F.CC[C@H](C)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CO)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C(C)C)C(N)=O. References: Bohm, S.K., Kong, W., Bromme, D., et al.Molecular cloning, expression and potential functions of the human proteinase-activated receptor-2Biochem. J.314(Pt 3)1009-1016(1996)