Lentztrehalose B

Lentztrehalose B is a disaccharide microbial metabolite that has been found in Lentzea and has diverse biological activities. It has antioxidant activity in an oxygen radical absorbance capacity (ORAC) assay when used at a concentration of 100 µM. Lentztrehalose B (10 mM) inhibits the activity of porcine kidney trehalase, the trehalose metabolizing enzyme. It induces autophagy in MeWo melanoma and OVK18 ovarian cancer cells when used at a concentration of 100 mM.Formal Name: alpha-D-glucopyranosyl 4-O-(3-methyl-2-buten-1-yl)-alpha-D-glucopyranoside. CAS Number: 1808096-67-4. Molecular Formula: C17H30O11. Formula Weight: 410.4. Purity: >80%. Formulation: (Request formulation change), A solid. Solubility: DMSO: Soluble, Methanol: Soluble, Water: Soluble. SMILES: C/C(C)=C/CO[C@@H]1[C@H](O[C@@H]([C@@H]([C@H]1O)O)O[C@H]2O[C@@H]([C@H]([C@@H]([C@H]2O)O)O)CO)CO. InChi Code: InChI=1S/C17H30O11/c1-7(2)3-4-25-15-9(6-19)27-17(14(24)12(15)22)28-16-13(23)11(21)10(20)8(5-18)26-16/h3,8-24H,4-6H2,1-2H3/t8-,9-,10-,11+,12-,13-,14-,15-,16-,17-/m1/s1. InChi Key: NODZOHVOYATRLP-JFQXGGNQSA-N. Origin: Bacterium/Lentzea sp. ML457-mF8.