Germicidin B

Germicidin B is a pyranone antibiotic originally derived from Streptomyces. It acts as a reversible, autoregulative inhibitor of spore germination and hyphal elongation in the genus Streptomyces at concentrations as low as 200 pM. During germination, spores of Streptomyces excrete germicidin B along with other germicidin homologs, which inhibit germination of its own arthrospores. At higher concentrations, germicidin can inhibit the porcine brain Na+/K+-dependent ATPase (ID50 = 100 µM) and prevent the germination of the cress L. sativum.Formal Name: 3-ethyl-4-hydroxy-6-(1-methylethyl)-2H-pyran-2-one. CAS Number: 150973-78-7. Molecular Formula: C10H14O3. Formula Weight: 182.2. Purity: >95%. Formulation: (Request formulation change), A solid. Solubility: DMF: Soluble, DMSO: Soluble, Ethanol: Soluble, Methanol: Soluble. SMILES: O=C1OC(C(C)C)=CC(O)=C1CC. InChi Code: InChI=1S/C10H14O3/c1-4-7-8(11)5-9(6(2)3)13-10(7)12/h5-6,11H,4H2,1-3H3. InChi Key: SZBDLUWYHDLLAG-UHFFFAOYSA-N. Origin: Bacterium/Streptomyces sp..