Elesclomol

Elesclomol is an inducer of apoptosis and a copper ionophore. It induces the production of reactive oxygen species (ROS) and increases oxidative stress response gene expression in Ramos (RA 1) B cell lymphoma cells when used at a concentration of 500 nM. Elesclomol (100 nM) disrupts the mitochondrial membrane potential and induces apoptosis in Ramos (RA 1) cells. It induces ferroptosis by selectively transporting copper into the inner mitochondrial membrane in MDA-MB-435 breast cancer cells. Elesclomol preloaded with copper (3.6 mg/kg) increases brain mitochondrial copper and mitochondrial complex IV, also known as cytochrome c oxidase, levels, as well as increases survival time, body weight, and brain weight and prevents changes in neuronal morphology in a mottled-brindled mouse model of Menkes disease, a fatal, X-linked condition characterized by copper-transporting ATPase (ATP7A) gene mutation, which produces altered catecholamine and copper levels, hypopigmentation, and severe neurodegeneration.Formal Name: 1,3-bis[2-methyl-2-(phenylthioxomethyl)hydrazide]-propanedioic acid. CAS Number: 488832-69-5. Synonyms: NSC 174939, STA 4783. Molecular Formula: C19H20N4O2S2. Formula Weight: 400.5. Purity: >98%. Formulation: (Request formulation change), A crystalline solid. Solubility: DMF: 30 mg/ml, DMSO: 25 mg/ml, Ethanol: 0.1 mg/ml. lambdamax: 243, 284 nm. SMILES: O=C(CC(=O)NN(C)C(=S)c1ccccc1)NN(C)C(=S)c1ccccc1. InChi Code: InChI=1S/C19H20N4O2S2/c1-22(18(26)14-9-5-3-6-10-14)20-16(24)13-17(25)21-23(2)19(27)15-11-7-4-8-12-15/h3-12H,13H2,1-2H3,(H,20,24)(H,21,25). InChi Key: BKJIXTWSNXCKJH-UHFFFAOYSA-N.