Serum thymic factor acetate

Description: Serum thymic factor acetate (Thymulin acetate) is the acetylated form of Serum thymic factor. This zinc-dependent immunoregulatory peptide hormone is produced by thymic epithelial cells. It stimulates pituitary release hormones, exhibiting pro-pituitary activities. Serum thymic factor acetate protects rats from nephrotoxicity caused by Cephaloridine through the inhibition of ERK activation. Additionally, it possesses anti-diabetic, anti-inflammatory, and analgesic properties, making it useful in the research of endocrine, reproductive, neurodegenerative, and inflammatory diseases. Smiles: C(C)(O)=O.[C@H](C(N[C@H](C(N[C@H](C(NCC(NCC(N[C@H](C(N[C@@H](CC(N)=O)C(O)=O)=O)CO)=O)=O)=O)CCC(N)=O)=O)CO)=O)(NC([C@@H](NC(=O)[C@@H]1CCC(=O)N1)C)=O)CCCCN