IALYLQQNW

Description: IALYLQQNW is a specific nonapeptide sequence derived from the Epstein-Barr virus (EBV) encoded tumor-associated latent membrane protein 1 (LMP1). As a potential T-cell epitope, IALYLQQNW has the ability to activate EBV-specific cytotoxic T lymphocytes (CTLs), which can recognize and eliminate EBV-infected cells expressing LMP1. This peptide plays a vital role in the immune response against EBV-associated tumors and is utilized in research on Hodgkins disease and nasopharyngeal carcinoma. Smiles: C([C@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@H](CC1=CC=C(O)C=C1)NC([C@@H](NC([C@@H](NC([C@H]([C@H](CC)C)N)=O)C)=O)CC(C)C)=O)=O)CC(C)C)=O)CCC(N)=O)=O)CCC(N)=O)=O)CC(N)=O)=O)C(O)=O)C=2C=3C(NC2)=CC=CC3