Heart-homing peptide

Description: Heart-homing peptide, abbreviated as CRPPR, is a linear peptide consisting of arginine-rich sequences. Identified as a cardiac-homing peptide due to its specific ability to bind to cardiac endothelium, CRPPR has been proposed to interact with Cysteine-rich intestinal protein-2 (CRIP-2) as its receptor. Additionally, this peptide is utilized for binding to liposomes. Smiles: C(=O)([C@H]1N(C([C@@H](NC([C@H](CS)N)=O)CCCNC(=N)N)=O)CCC1)N2[C@H](C(N[C@@H](CCCNC(=N)N)C(O)=O)=O)CCC2