Ganglioside GM1-binding peptides p3

Description: Ganglioside GM1-binding peptide sp3 is a synthetically engineered peptide that specifically binds to the pentasaccharide region of GM1 ganglioside. The dynamic transitions of Ganglioside GM1-binding peptide sp3 may play a crucial role in the functions of GM1 as a receptor for various ligands, such as in the conventional pathway of cholera toxin infection. This peptide is useful for studies on the interactions between GM1 and its ligands. Smiles: C([C@@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(=O)N1[C@H](C(=O)N2[C@H](C(N[C@@H](CC3=CC=CC=C3)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(=O)N4[C@H](C(O)=O)CCC4)CC(C)C)=O)CC(C)C)=O)CCCNC(=N)N)=O)CC(N)=O)=O)CO)=O)=O)CCC2)CCC1)C)=O)CC(C)C)=O)CC(C)C)=O)CCCNC(=N)N)=O)NC([C@H](C(C)C)N)=O)C=5C=6C(NC5)=CC=CC6