DOTA-cyclo(RGDfK)

Description: DOTA-cyclo(RGDfK) is a and DOTA-like chelator peptide consisting of a dimer of the peptide cross-linker DOTA and the cyclic peptide RGDFK, which preferentially targets the alphavbeta3 integrin receptor expressed on tumor cell membranes, allowing for the preparation of radionuclide coupled compounds (RDCs) and their use in cancer diagnostics and therapy. Target: Integrin. Smiles: C([C@@H]1C(=O)N[C@@H](CCCCNC(CN2CCN(CC(O)=O)CCN(CC(O)=O)CCN(CC(O)=O)CC2)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)NCC(=O)N[C@@H](CC(O)=O)C(=O)N1)C3=CC=CC=C3