(D-His(Bzl)6)-LHRH (1-7) (free acid)

Description: (D-His(Bzl)6)-LHRH (1-7) free acid is a synthetic peptide derived from luteinizing hormone-releasing hormone (LHRH). It achieves enhanced stability and biological activity through the introduction of non-natural amino acid residues at specific positions within the LHRH molecule. This modification extends the drug's half-life in the body, reduces its rate of rapid metabolism and clearance, and subsequently increases its efficacy in inhibiting cell proliferation. Smiles: C([C@H](NC([C@H](CC1=CN=CN1)NC(=O)[C@@H]2CCC(=O)N2)=O)C(N[C@H](C(N[C@@H](CC3=CC=C(O)C=C3)C(N[C@H](CC4=CN(CC5=CC=CC=C5)C=N4)C(N[C@@H](CC(C)C)C(O)=O)=O)=O)=O)CO)=O)C=6C=7C(NC6)=CC=CC7