Description: (R)-HTS-3, a lysophosphatidylcholinacyltransferase 3 (LPCAT3) inhibitor, remodels polyunsaturated phospholipid content in human cells and reduces RSL3-induced ferroptosis in cancer cells. Target: Acyltransferase, Ferroptosis. Smiles: [C@@H](CNC(=O)C1=CC(F)=CC(F)=C1)(N(C)C)C2=CC=CC=C2. References: Reed...

(R)-HTS-3 is an inhibitor of lysophosphatidylcholine acyltransferase 3 (LPCAT3, IC50 = 0.09 µM), an enzyme involved in the synthesis of C20:4-containing phospholipids. It reduces the incorporation of arachidonic acid-d8 (Cay-390010) into phospholipids when used at concentrations of 1, 3, and 10 µM. (R)-HTS-3 (10 µM)...