PDGFR TKI III

A PDGFRalpha and PDGFRbeta inhibitor (IC50s = 0.05 and 0.13 µM, respectively), selective for PDGFRalpha and PDGFRbeta over FGFR, EGFR, PKA, and PKC (IC50s = 29.7, >30, >30, and >30 µM, respectively) but does inhibit c-Kit and FLT3 (IC50s = 0.05 and 0.23 µM, respectively), inhibits PDGF homodimer-induced proliferation of pig aorta smooth muscle cells (IC50 = 0.25 µM), inhibits the migration of primary mouse DA-MSCs induced by embryonic mouse blood at 2 µM. Formulation: A solid. InChI: InChI=1S/C27H27N5O4/c1-34-24-16-22-23(17-25(24)35-2)28-18-29-26(22)31-12-14-32(15-13-31)27(33)30-19-8-10-21(11-9-19)36-20-6-4-3-5-7-20/h3-11,16-18H,12-15H2,1-2H3,(H,30,33). InChIKey: INTPTKHSGKBHHW-UHFFFAOYSA-N. SMILES: O=C(N(C1=CC=C(OC2=CC=CC=C2)C=C1)[H])N3CCN(C4=NC=NC5=C4C=C(OC)C(OC)=C5)CC3