JNJ-5207787

JNJ-5207787 is an antagonist of the neuropeptide Y (NPY) receptor Y2 that blocks peptide YY binding (IC50 = 100 nM). It displays 100-fold selectivity for Y2 over other NPY receptors and has minimal effect on a panel of 50 receptors, ion channels, and transporters, except for sodium channel 2. JNJ-5207787 is intraperitoneally bioavailable and brain penetrant in rats, occupying maximally 50% of Y2 receptor binding sites in the hypothalamic area.Formal Name: (2E)-N-(1-acetyl-2,3-dihydro-1H-indol-6-yl)-3-(3-cyanophenyl)-N-[1-(2-cyclopentylethyl)-4-piperidinyl]-2-propenamide. CAS Number: 683746-68-1. Molecular Formula: C32H38N4O2. Formula Weight: 510.7. Purity: >98%. Formulation: (Request formulation change), A crystalline solid. Solubility: DMSO: 5 mg/ml (gentle warming), Ethanol: 5 mg/ml (gentle warming). lambdamax: 219, 262 nm. SMILES: O=C(/C=C/C1=CC=CC(C#N)=C1)N(C2=CC=C(CCN3C(C)=O)C3=C2)C4CCN(CCC5CCCC5)CC4. InChi Code: InChI=1S/C32H38N4O2/c1-24(37)35-20-14-28-10-11-30(22-31(28)35)36(32(38)12-9-26-7-4-8-27(21-26)23-33)29-15-18-34(19-16-29)17-13-25-5-2-3-6-25/h4,7-12,21-22,25,29H,2-3,5-6,13-20H2,1H3/b12-9+. InChi Key: DSEJCLDJIFTPPH-FMIVXFBMSA-N.