HS-38

A DAPK1 (IC50 = 200 nM) and DAPK3 inhibitor, selectively binds to DAPK1, DAPK2, and DAPK3 (Kds = 300, 79, and 280 nM, respectively) over Pim-1, Pim-2, and Pim-3 (Kds = 1,800, 6,500, and 810 nM, respectively) but does inhibit Pim-3 (IC50 = 200 nM), inhibits phosphorylation of RLC20 in primary human coronary artery smooth muscle cells at 10 µM, reduces phenylephrine-induced contractions in isolated mouse aortic rings and increases the time to reach 50% maximal contractions in calyculin A-stimulated isolated rat caudal arterial smooth muscle strips at 10 and 100 µM, respectively. Formulation: A solid. InChI: InChI=1S/C14H12ClN5O2S/c1-7(11(16)21)23-14-18-12-10(13(22)19-14)6-17-20(12)9-4-2-3-8(15)5-9/h2-7H,1H3,(H2,16,21)(H,18,19,22). InChIKey: NASYEGAVCTZSDO-UHFFFAOYSA-N. SMILES: O=C(N)C(SC1=NC(C2=C(N1)N(N=C2)C3=CC(Cl)=CC=C3)=O)C