No results were found for the filter!
Dovitinib (lactate)
Item number: Cay41394-1
A multi-kinase inhibitor, inhibits FLT3, CSF1R, c-Kit, FGFR1, FGFR3, VEGFR1, -2, and -3, PDFGRalpha, and PDGFRbeta (IC50s = 1, 36, 2, 8, 9, 10, 13, 8, 27, and 210 nM, respectively), inhibits the proliferation of human multiple myeloma cell lines expressing mutant, but not wild-type, FGFR3 (IC50s = 90-550 and >2,500...
| Keywords: | CHIR258, TKI-258, 2-hydroxy-propanoic acid, compd. with... |
| Application: | Multi-kinase inhibitor |
| CAS | 852433-84-2 |
| MW: | 572.59 D |
From 45.00€
*
ML-401
Item number: Cay41450-10
An EBI2 antagonist (IC50 = 1.03 nM), inhibits RS11846 cell chemotaxis (IC50 = 4.533 nM). Formulation: A solid. InChI: InChI=1S/C20H20BrClN2O/c21-18-6-1-16(2-7-18)5-10-20(25)24-13-11-23(12-14-24)15-17-3-8-19(22)9-4-17/h1-10H,11-15H2/b10-5+. InChIKey: NXTNVQJKGHAGAX-BJMVGYQFSA-N. SMILES:...
| Keywords: | (2E)-3-(4-bromophenyl)-1-[4-[(4-chlorophenyl)methyl]-1-piperazinyl]-2-propen-1-one |
| Application: | EBI2 antagonist |
| CAS | 1597489-14-9 |
| MW: | 419.74 D |
From 116.00€
*
Isoleucine
Item number: Cay41562-50
A mixture of isoleucine diastereomers. Formulation: A solid. InChI: InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9). InChIKey: AGPKZVBTJJNPAG-UHFFFAOYSA-N. SMILES: CCC(C)C(N)C(O)=O
| Keywords: | 2-amino-3-methyl-pentanoic acid |
| Application: | Isoleucine diastereomer mixture |
| CAS | 2095501-92-9 |
| MW: | 131.2 D |
55.00€
*
GSK3685032
Item number: Cay41882-1
A DNMT1 inhibitor (IC50 = 0.23 µM), selective for DNMT1 over DNMT3A/3L and DNMT3B/3L and a panel of 34 methyltransferases and 369 kinases (IC50s = >10 µM for all), inhibits the proliferation of 51 hematological cancer cell lines (median IC50 = 0.64 µM), decreases overall DNA methylation and gene expression in...
| Keywords: | aR-[[6-(4-amino-1-piperidinyl)-3,5-dicyano-4-ethyl-2-pyridinyl]thio]-benzeneacetamide |
| Application: | DNMT1 inhibitor |
| CAS | 2170140-50-6 |
| MW: | 420.54 D |
From 104.00€
*
Santalol
Item number: Cay41891-100
A mixture of alpha-santalol and beta-santalol. Formulation: A neat oil. InChI: InChI=1S/2C15H24O/c1-10(9-16)5-4-6-14(2)11-7-12-13(8-11)15(12,14)3,1-11(10-16)5-4-8-15(3)12(2)13-6-7-14(15)9-13/h5,11-13,16H,4,6-9H2,1-3H3,5,13-14,16H,2,4,6-10H2,1,3H3/b10-5-,11-5-/t11?,12-,13?,14+,15?,13-,14+,15+/m01/s1. InChIKey:...
| Application: | Sesquiterpenoids, alpha-santalol/beta-santalol mixture |
| CAS | 11031-45-1 |
| MW: | 220.4 D |
From 45.00€
*
BH400
Item number: Cay41892-1
A PPARalpha agonist and STING inhibitor (IC50 = 8.1 µM), induces transactivation of PPARalpha in a reporter assay using THP-1 cells (EC50 = 1.2 µM), inhibits 4-HNE- or H2O2-induced decreases in viability in 661W cells at 10 µM, prevents LPS-induced increases in phosphorylated TBK1 and IL-6 levels and LPS-induced...
| Keywords: | 5-(((4'-fluoro-[1,1'-biphenyl]-4-yl)methyl)amino)-2-hydroxybenzoic acid |
| Application: | PPARalpha agonist, STING inhibitor |
| MW: | 337.4 D |
From 116.00€
*
DBCO-amine
Item number: Cay41895-100
A copper-free click chemistry reagent, has been used in the synthesis of clickable fluorescent probes. Formulation: A solid. InChI: InChI=1S/C18H16N2O/c19-12-11-18(21)20-13-16-7-2-1-5-14(16)9-10-15-6-3-4-8-17(15)20/h1-8H,11-13,19H2. InChIKey: OCCYFTDHSHTFER-UHFFFAOYSA-N. SMILES: O=C(CCN)N1CC2=C(C#CC3=C1C=CC=C3)C=CC=C2
| Keywords: | Dibenzylcyclooctyne-amine, 3-amino-1-(11,12-didehydrodibenz[b,f]azocin-5(6H)-yl)-1-propanone |
| Application: | Copper-free click chemistry reagent |
| CAS | 1255942-06-3 |
| MW: | 276.3 D |
From 130.00€
*
DL-Cysteine
Item number: Cay41968-1
A racemic mixture of D- and L-cysteine, prevents reserpine- and pyloric stenosis-induced gastric ulceration in rats at 5% w/v, improves motility and DNA integrity in frozen and thawed epididymal spermatozoa from cats in cryoprotectants at 5 mM. Formulation: A solid. InChI:...
| Keywords: | (±)-Cysteine, (R,S)-Cysteine, NSC 63864 |
| Application: | D-/L-cysteine racemic mixture |
| CAS | 3374-22-9 |
| MW: | 121.16 D |
From 40.00€
*
Fmoc-beta-Alanine
Item number: Cay41969-10
A building block, has been used in the solid-phase synthesis of glucagon receptor peptide antagonists and bradykinin B1 and B2 receptor pseudopeptide antagonists. Formulation: A solid. InChI: InChI=1S/C18H17NO4/c20-17(21)9-10-19-18(22)23-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16H,9-11H2,(H,19,22)(H,20,21)....
| Keywords: | Fmoc-beta-Ala-OH, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-beta-alanine |
| Application: | Building block |
| CAS | 35737-10-1 |
| MW: | 311.33 D |
From 40.00€
*
Coumarin 343
Item number: Cay41970-100
A coumarin laser dye, abs/em = 446/519 nm. Formulation: A solid. InChI: InChI=1S/C16H15NO4/c18-15(19)12-8-10-7-9-3-1-5-17-6-2-4-11(13(9)17)14(10)21-16(12)20/h7-8H,1-6H2,(H,18,19). InChIKey: KCDCNGXPPGQERR-UHFFFAOYSA-N. SMILES: O=C(C1=CC2=C(OC1=O)C(CCCN3CCC4)=C3C4=C2)O
| Keywords: | 2,3,6,7-tetrahydro-11-oxo-1H,5H,11H-[1]benzopyrano[6,7,8-ij]quinolizine-10-carboxylic acid |
| Application: | Coumarin laser dye |
| CAS | 55804-65-4 |
| MW: | 285.29 D |
From 55.00€
*
ARV-766
Item number: Cay41985-1
A PROTAC that drives androgen receptor degradation (DC50 = <1 nM), inhibits tumor growth in various LNCaP and VCaP prostate cancer mouse xenograft models, including an enzalutamide-insensitive, non-castrated VCaP model. Formulation: A solid. InChI:...
| Keywords: | Luxdegalutamide,... |
| Application: | Androgen receptor degradation driving PROTAC |
| CAS | 2750830-09-0 |
| MW: | 807.95 D |
From 119.00€
*
Paltusotine
Item number: Cay42041-10
An SST2 agonist, selectively inhibits cAMP production in cells expressing SST2 over cells expressing SST1, SST3, SST4, or SST5 (EC50s = 25, >1,000, >1,000, >1,000, and >1,000 nM, respectively), reduces GHRH-stimulated growth hormone release in rats at 3, 10, and 30 mg/kg, reduces plasma levels of IGF-1 in beagle...
| Keywords: | CRN00808, 3-[4-(4-amino-1-piperidinyl)-3-(3,5-difluorophenyl)-6-quinolinyl]-2-hydroxy-benzonitrile |
| Application: | SST2 agonist |
| CAS | 2172870-89-0 |
| MW: | 456.5 D |
From 421.00€
*