19 products were found matching "K12352"!
No results were found for the filter!
Anti-SMPD3 / Sphingomyelin phosphodiesterase 3 / nSMase2
Item number: NSJ-FY13150
Adding 0.2 ml of distilled water will yield a concentration of 500 ug/ml. SMPD3 antibody detects Sphingomyelin phosphodiesterase 3, a membrane-associated enzyme that hydrolyzes sphingomyelin to generate ceramide and phosphocholine. The UniProt recommended name is Sphingomyelin phosphodiesterase 3 (SMPD3). This...
| Keywords: | Anti-SMPD3, Anti-Neutral sphingomyelinase 2, Anti-Neutral sphingomyelinase II, Anti-Sphingomyelin phosphodiesterase 3,... |
| Application: | WB, ELISA |
| Host: | Rabbit |
| Species reactivity: | human |
790.00€
*
PDDC inhibitor
Item number: TGM-T69757-10mg
Description: PDDC inhibitor (Phenyl (R)-(1-(3-(3,4-dimethoxyphenyl)-2,6-dimethylimidazo[1,2-b]pyridazin-8-yl)pyrrolidin-3-yl)carbamate) is a selective and highly potent nSMase2 inhibitor. Target: HIV Protease. Smiles: CC=1N=C2N(C1C3=CC(OC)=C(OC)C=C3)N=C(C)C=C2N4C[C@H](NC(OC5=CC=CC=C5)=O)CC4. References: Siew ZY, et...
| Application: | nSMase2 inhibitor |
| CAS | 2232878-43-0 |
| MW: | 487.55 D |
From 238.00€
*
Sphingomyelin phosphodiesterase 3 (SMPD3), partial,...
Item number: CSB-EP878920HU1.1
Organism: Homo sapiens (Human). Source: E.coli. Expression Region: 86-655aa. Protein Length: Partial. Tag Info: N-terminal 10xHis-tagged and C-terminal Myc-tagged. Target Protein Sequence: SPLQSARRPY IYSRLEDKGL AGGAALLSEW KGTGPGKSFC FATANVCLLP DSLARVNNLF NTQARAKEIG QRIRNGAARP QIKIYIDSPT NTSISAASFS SLVSPQGGDG...
| Keywords: | nSMase2, nSMase-2, Neutral sphingomyelinase 2, Neutral sphingomyelinase II, Sphingomyelin phosphodiesterase 3, Recombinant... |
| Application: | Activity not tested |
| Expressed in: | E.coli |
| Origin: | human |
| MW: | 68.8 kD |
From 292.00€
*
Anti-SMPD3
Item number: ABS-KC-3999.100
Protein function: Catalyzes the hydrolysis of sphingomyelin to form ceramide and phosphocholine. Ceramide mediates numerous cellular functions, such as apoptosis and growth arrest, and is capable of regulating these 2 cellular events independently. Also hydrolyzes sphingosylphosphocholine. Regulates the cell cycle...
| Keywords: | Anti-Sphingomyelin phosphodiesterase 3, Anti-Neutral sphingomyelinase 2, Anti-nSMase-2, Anti-nSMase2, Anti-Neutral... |
| Application: | IHC |
| Host: | Mouse |
| Species reactivity: | human |
From 206.00€
*
Anti-SMPD3, recombinant antibody
Item number: ABS-RN-13691.100
Protein function: Catalyzes the hydrolysis of sphingomyelin to form ceramide and phosphocholine. Ceramide mediates numerous cellular functions, such as apoptosis and growth arrest, and is capable of regulating these 2 cellular events independently. Also hydrolyzes sphingosylphosphocholine. Regulates the cell cycle...
| Keywords: | Anti-nSMase2, Anti-nSMase-2, Anti-Neutral sphingomyelinase 2, Anti-Neutral sphingomyelinase II, Anti-Sphingomyelin... |
| Host: | Mouse |
| Species reactivity: | human |
From 206.00€
*
Anti-SMPD3, recombinant antibody
Item number: ABS-RN-13731.100
Protein function: Catalyzes the hydrolysis of sphingomyelin to form ceramide and phosphocholine. Ceramide mediates numerous cellular functions, such as apoptosis and growth arrest, and is capable of regulating these 2 cellular events independently. Also hydrolyzes sphingosylphosphocholine. Regulates the cell cycle...
| Keywords: | Anti-nSMase2, Anti-nSMase-2, Anti-Neutral sphingomyelinase 2, Anti-Neutral sphingomyelinase II, Anti-Sphingomyelin... |
| Application: | IP, ChIP |
| Host: | Mouse |
| Species reactivity: | human |
From 206.00€
*
SMPD3 (human), recombinant protein
Item number: ABS-PP-1187-L.100
Protein function: Catalyzes the hydrolysis of sphingomyelin to form ceramide and phosphocholine. Ceramide mediates numerous cellular functions, such as apoptosis and growth arrest, and is capable of regulating these 2 cellular events independently. Also hydrolyzes sphingosylphosphocholine. Regulates the cell cycle...
| Keywords: | Sphingomyelin phosphodiesterase 3, Neutral sphingomyelinase 2, nSMase-2, nSMase2, Neutral sphingomyelinase II, Recombinant... |
| Expressed in: | E.coli |
| Origin: | human |
| MW: | 11 kD |
From 115.00€
*
Anti-smpd5
Item number: CSB-PA197921XA01DIL.100
Make to order. Production time: 70-80 business days. Deliverables: 1. 200 µg antigen (used as positive control), 2. 1 ml pre-immune serum (used as negative control) , 3. Rabbit polyclonal antibody, antigen affinity purified. Quality Guarantee: 1. Antibody purity > 90% confirmed by SDS-PAGE, 2. Antibody titer > 1:...
| Keywords: | Anti-mtnSMase, Anti-Sphingomyelin phosphodiesterase 5, Anti-Mitochondrial neutral sphingomyelinase, smpd5 Antibody |
| Application: | ELISA, WB |
| Host: | Rabbit |
| Species reactivity: | Danio rerio (Zebrafish) (Brachydanio rerio) |
From 1,529.00€
*
SMPD3, Human sphingomyelin phosphodiesterase 3, neutral...
Item number: VHPS-8671
Primers are provided as a 40 µl solution containing both primers at a final concentration of 50 µM in 10 mM Tris-HCl (pH 7.5), 0.1 mM EDTA. Dilute with water as needed prior to use. This amount is sufficient for 1000 x 20µl PCR reactions assuming a final primer concentration of 0.1 µM. Add cDNA template....
| Keywords: | SMPD3, nSMase2, nSMase-2, EC=3.1.4.12, Neutral sphingomyelinase 2, Neutral sphingomyelinase II, Sphingomyelin... |
| Application: | RNA quantification |
45.00€
*
Smpd3, Mouse sphingomyelin phosphodiesterase 3, neutral,...
Item number: VMPS-6132
Primers are provided as a 40 µl solution containing both primers at a final concentration of 50 µM in 10 mM Tris-HCl (pH 7.5), 0.1 mM EDTA. Dilute with water as needed prior to use. This amount is sufficient for 1000 x 20µl PCR reactions assuming a final primer concentration of 0.1 µM. Add cDNA template....
| Keywords: | Smpd3, nSMase2, nSMase-2, EC=3.1.4.12, Neutral sphingomyelinase 2, Neutral sphingomyelinase II, Sphingomyelin... |
| Application: | RNA quantification |
45.00€
*
Smpd3, Rat sphingomyelin phosphodiesterase 3, neutral,...
Item number: VRPS-5844
Primers are provided as a 40 µl solution containing both primers at a final concentration of 50 µM in 10 mM Tris-HCl (pH 7.5), 0.1 mM EDTA. Dilute with water as needed prior to use. This amount is sufficient for 1000 x 20µl PCR reactions assuming a final primer concentration of 0.1 µM. Add cDNA template....
| Keywords: | Cca1, Smpd3, nSMase2, nSMase-2, EC=3.1.4.12, Neutral sphingomyelinase 2, Neutral sphingomyelinase II, Sphingomyelin... |
| Application: | RNA quantification |
54.00€
*
Anti-SMPD3, NT (SMPD3, Sphingomyelin phosphodiesterase 3,...
Item number: 042056.200
SMPD3 catalyzes the hydrolysis of sphingomyelin to form ceramide and phosphocholine. Ceramide mediates numerous cellular functions, such as apoptosis and growth arrest, and is capable of regulating these 2 cellular events independently. Also hydrolyzes sphingosylphosphocholine. Regulates the cell cycle by acting as...
| Keywords: | Anti-SMPD3, Anti-nSMase2, Anti-nSMase-2, EC=3.1.4.12, Anti-Neutral sphingomyelinase 2, Anti-Neutral sphingomyelinase II,... |
| Application: | ELISA, WB |
| Host: | Rabbit |
| Species reactivity: | human |
865.00€
*