- Search results for K11841
Cookie preferences
This website uses cookies, which are necessary for the technical operation of the website and are always set. Other cookies, which increase the comfort when using this website, are used for direct advertising or to facilitate interaction with other websites and social networks, are only set with your consent.
Configuration
Technically required
These cookies are necessary for the basic functions of the shop.
"Allow all cookies" cookie
"Decline all cookies" cookie
CSRF token
Cookie preferences
Currency change
Customer-specific caching
FACT-Finder tracking
Individual prices
Selected shop
Session
Comfort functions
These cookies are used to make the shopping experience even more appealing, for example for the recognition of the visitor.
Note
Show the facebook fanpage in the right blod sidebar
Statistics & Tracking
Affiliate program
Conversion and usertracking via Google Tag Manager
Track device being used
37 products were found matching "K11841"!
Close filters
Filter by:
No results were found for the filter!
Item number: Cay17769-5
Spautin-1 is an autophagy inhibitor, inducing cell death in human breast cancer Bcap-37 cells grown in glucose-free media (EC50 = ~1.25 µM). It does not significantly affect the viability of Bcap-37 cells grown in complete media. Spautin-1 promotes the degradation of Vps34 PI3K complex by inhibiting the...
| Keywords: | 6-fluoro-N-[(4-fluorophenyl)methyl]-4-quinazolinamine |
| Application: | Autophagy inhibitor, USP10 / USP13 inhibitor |
| CAS | 1262888-28-7 |
| MW: | 271.3 D |
From 49.00€
*
Item number: A300-900A
Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....
| Keywords: | Anti-USP10, Anti-KIAA0190, Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin... |
| Application: | WB, IP, IHC |
| Host: | Rabbit |
| Species reactivity: | human, mouse |
From 165.00€
*
Item number: A300-901A
Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....
| Keywords: | Anti-USP10, Anti-KIAA0190, Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin... |
| Application: | WB, IP, IHC |
| Host: | Rabbit |
| Species reactivity: | human |
From 165.00€
*
Item number: ATA-HPA006731.100
Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....
| Keywords: | Anti-USP10, Anti-KIAA0190, Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin... |
| Application: | WB, IHC, ICC |
| Host: | Rabbit |
| Species reactivity: | human |
From 246.00€
*
Item number: BPS-79094
The USP10 Inhibitor Screening Assay Kit is a fluorogenic assay designed to measure the activity of the deubiquitinating (DUB) enzyme USP10 (Ubiquitin Specific Peptidase 10) for screening and profiling applications. The kit comes in a convenient 96-well format and contains enough purified recombinant human USP10...
| Keywords: | Ubiquitin thioesterase 10, Deubiquitinating enzyme 10, Ubiquitin carboxyl-terminal hydrolase 10,... |
| Application: | Enzyme kinetics, small molecule inhibitor screening, drug discovery, HTS |
| Species reactivity: | human |
1,336.00€
*
Item number: BPS-80360
Human USP10 (Ubiquitin-Specific Protease 10) or Ubiquitin C-terminal Hydrolase 10, GenBank Accession No. NM_005153, amino-acids 2-798(end) with an N-terminal FLAG-tag, MW=88 kDa, expressed in a baculovirus-infected Sf9 cell expression system.
| Keywords: | Ubiquitin thioesterase 10, Deubiquitinating enzyme 10, Ubiquitin carboxyl-terminal hydrolase 10,... |
| Application: | Enzyme kinetics, inhibitor screening, selectivity profiling |
| Expressed in: | Baculovirus |
| Origin: | human |
| MW: | 88 kD |
640.00€
*
Item number: IHC-00175
Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....
| Keywords: | Anti-USP10, Anti-KIAA0190, Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin... |
| Application: | IHC |
| Host: | Rabbit |
| Species reactivity: | human |
From 165.00€
*
Item number: ARG59722.100
Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....
| Keywords: | Anti-USP10, Anti-KIAA0190, Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin... |
| Application: | ICC, IF, IHC (paraffin), IP, WB |
| Host: | Rabbit |
| Species reactivity: | human |
658.00€
*
Item number: ARG59808.100
Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....
| Keywords: | Anti-USP10, Anti-KIAA0190, Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin... |
| Application: | ICC, IF, WB |
| Host: | Rabbit |
| Species reactivity: | human, mouse |
707.00€
*
Item number: ATA-HPA006749.100
Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....
| Keywords: | Anti-USP10, Anti-KIAA0190, Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin... |
| Application: | IHC, ICC |
| Host: | Rabbit |
| Species reactivity: | human |
From 246.00€
*
Item number: NSJ-RQ7110
0.5mg/ml if reconstituted with 0.2ml sterile DI water. Ubiquitin specific peptidase 10, also known as USP10, is an enzyme which in humans is encoded by the USP10 gene. Ubiquitin is a highly conserved protein that is covalently linked to other proteins to regulate their function and degradation. This gene encodes a...
| Keywords: | Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin carboxyl-terminal hydrolase 10,... |
| Application: | WB, Direct ELISA |
| Host: | Rabbit |
| Species reactivity: | human, mouse, rat |
790.00€
*
Item number: TGM-T1937-100mg
Description: Spautin-1 is a novel autophagy inhibitor, IM inhibited the growth of K562 cells with IC50 of 1.03 µM. In contrast, co-treatment with Spautin-1 increased IM-induced inhibition of cell viability with IC50 of 0.45 µM. Target: Apoptosis, DUB, Autophagy. Smiles: Fc1ccc(CNc2ncnc3ccc(F)cc23)cc1. References:...
| Keywords: | Spautin 1 |
| Application: | Autophagy inhibitor, USP10 / USP13 inhibitor |
| CAS | 1262888-28-7 |
| MW: | 271.26 D |
From 32.00€
*