49 products were found matching "K10901"!
No results were found for the filter!
Anti-BLM
Item number: ATA-HPA050427.100
Rabbit Polyclonal BLM Antibody against Human BLM RecQ like helicase. Validated for Western Blot. Buffer: 40% glycerol and PBS (pH 7.2). 0.02% sodium azide is added as preservative. Interspecies information: Highest antigen sequence indentity to the following orthologs: ENSMUSG00000030528: 84%, ENSRNOG00000011213:...
| Keywords: | Anti-BLM, Anti-RecQ2, Anti-RECQ2, Anti-RecQ protein-like 3, Anti-Bloom syndrome protein, Anti-DNA helicase, RecQ-like type 2 |
| Application: | WB |
| Host: | Rabbit |
| Species reactivity: | human |
From 330.00€
*
Anti-BLM
Item number: A300-120A
Protein function: Participates in DNA replication and repair. Exhibits a magnesium-dependent ATP-dependent DNA-helicase activity that unwinds single- and double-stranded DNA in a 3'-5' direction. Involved in 5'-end resection of DNA during double-strand break (DSB) repair: unwinds DNA and recruits DNA2 which mediates...
| Keywords: | Anti-BLM, Anti-RecQ2, Anti-RECQ2, EC=3.6.4.12, Anti-RecQ protein-like 3, Anti-Bloom syndrome protein, Anti-DNA helicase,... |
| Application: | WB, IP |
| Host: | Goat |
| Species reactivity: | human |
From 165.00€
*
Anti-BLM
Item number: A300-110A
Protein function: Participates in DNA replication and repair. Exhibits a magnesium-dependent ATP-dependent DNA-helicase activity that unwinds single- and double-stranded DNA in a 3'-5' direction. Involved in 5'-end resection of DNA during double-strand break (DSB) repair: unwinds DNA and recruits DNA2 which mediates...
| Keywords: | Anti-BLM, Anti-RecQ2, Anti-RECQ2, EC=3.6.4.12, Anti-RecQ protein-like 3, Anti-Bloom syndrome protein, Anti-DNA helicase,... |
| Application: | WB, IP |
| Host: | Rabbit |
| Species reactivity: | human, mouse |
From 165.00€
*
Anti-BLM
Item number: A300-572A
Protein function: Participates in DNA replication and repair. Exhibits a magnesium-dependent ATP-dependent DNA-helicase activity that unwinds single- and double-stranded DNA in a 3'-5' direction. Involved in 5'-end resection of DNA during double-strand break (DSB) repair: unwinds DNA and recruits DNA2 which mediates...
| Keywords: | Anti-Bloom syndrome protein homolog |
| Application: | WB, IP |
| Host: | Rabbit |
| Species reactivity: | human, mouse |
From 165.00€
*
Anti-BLM
Item number: A300-570A-T
Protein function: Participates in DNA replication and repair. Exhibits a magnesium-dependent ATP-dependent DNA-helicase activity that unwinds single- and double-stranded DNA in a 3'-5' direction. Involved in 5'-end resection of DNA during double-strand break (DSB) repair: unwinds DNA and recruits DNA2 which mediates...
| Keywords: | Anti-Bloom syndrome protein homolog |
| Application: | WB, IP |
| Host: | Rabbit |
| Species reactivity: | mouse |
From 165.00€
*
ML-216
Item number: Cay15186-1
. Bloom (BLM) helicase is a DNA unwinding enzyme important for DNA repair in the homologous recombination pathway. Mutations of the BLM gene result in reduced BLM helicase activity that is associated with the rare genetic disorder, Bloom's Syndrome, and a predisposition to developing cancer. ML-216 is the first...
| Keywords: | CID-49852229, N-[4-fluoro-3-(trifluoromethyl)phenyl]-N'-[5-(4-pyridinyl)-1,3,4-thiadiazol-2-yl]-urea |
| Application: | BLM helicase inhibitor |
| CAS | 1430213-30-1 |
| MW: | 383.3 D |
From 49.00€
*
Anti-BLM / Blooms Syndrome Protein
Item number: ARG66736.100
Protein function: ATP-dependent DNA helicase that unwinds single- and double- stranded DNA in a 3'-5' direction (PubMed:9388193, PubMed:24816114, PubMed:25901030). Participates in DNA replication and repair (PubMed:12019152, PubMed:21325134, PubMed:23509288). Involved in 5'-end resection of DNA during double-strand...
| Keywords: | Anti-BLM, Anti-RecQ2, Anti-RECQ2, Anti-RecQ protein-like 3, Anti-Bloom syndrome protein, Anti-DNA helicase, RecQ-like type 2 |
| Application: | ICC, IF, IHC (paraffin) |
| Host: | Rabbit |
| Species reactivity: | human |
658.00€
*
Anti-BLM
Item number: ATA-HPA005689.100
Protein function: ATP-dependent DNA helicase that unwinds single- and double- stranded DNA in a 3'-5' direction (PubMed:9388193, PubMed:24816114, PubMed:25901030). Participates in DNA replication and repair (PubMed:12019152, PubMed:21325134, PubMed:23509288). Involved in 5'-end resection of DNA during double-strand...
| Keywords: | Anti-BLM, Anti-RECQ2, Anti-RecQ2, Anti-RecQ protein-like 3, Anti-Bloom syndrome protein, Anti-DNA helicase, RecQ-like type 2 |
| Application: | ICC, IHC |
| Host: | Rabbit |
| Species reactivity: | human |
From 330.00€
*
Bloom syndrome protein homolog (Blm), partial, mouse,...
Item number: CSB-EP002715MO.1
Organism: Mus musculus (Mouse). Source: E.coli. Expression Region: 684-859aa. Protein Length: Partial. Tag Info: N-terminal 10xHis-tagged and C-terminal MYC-tagged. Target Protein Sequence: INAALLGEDC FILMPTGGGK SLCYQLPACV SPGVTIVISP LRSLIVDQVQ KLTSFDIPAT YLTGDKTDSE AANIYLQLSK KDPIIKLLYV TPEKVCASNR LISTLENLYE...
| Keywords: | Blm, mBLM, RecQ helicase homolog, Bloom syndrome protein homolog, Recombinant Mouse Bloom syndrome protein homolog (Blm),... |
| Application: | Activity not tested |
| Expressed in: | E.coli |
| Origin: | mouse |
| MW: | 24.7 kD |
From 292.00€
*
RecQ-like DNA helicase BLM (BLM), partial, human,...
Item number: CSB-EP002715HU.1
Organism: Homo sapiens (Human). Source: E.coli. Expression Region: 877-1024aa. Protein Length: Partial. Tag Info: N-terminal 6xHis-tagged. Target Protein Sequence: DCLEWIRKHH PYDSGIIYCL SRRECDTMAD TLQRDGLAAL AYHAGLSDSA RDEVQQKWIN QDGCQVICAT IAFGMGIDKP DVRFVIHASL PKSVEGYYQE SGRAGRDGEI SHCLLFYTYH DVTRLKRLIM MEKDGNHHTR...
| Keywords: | BLM, RECQ2, RecQ2, RecQ protein-like 3, Bloom syndrome protein, DNA helicase, RecQ-like type 2, Recombinant Human... |
| Application: | Activity not tested |
| Expressed in: | E.coli |
| Origin: | human |
| MW: | 23.0 kD |
From 247.00€
*
Anti-Phospho-BLM (Thr99)
Item number: CSB-PA188391.100
Host Species: Rabbit. Isotype: IgG. Buffer: Rabbit IgG in phosphate buffered saline (without Mg2+ and Ca2+), pH 7.4, 150mM NaCl, 0.02% sodium azide and 50% glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antibodies were produced by immunizing rabbits with...
| Keywords: | Anti-phospho-BLM, Anti-phospho-RECQ2, Anti-phospho-RecQ2, Anti-phospho-RecQ protein-like 3, Anti-phospho-Bloom syndrome... |
| Application: | ELISA, WB, IHC |
| Host: | Rabbit |
| Species reactivity: | human |
340.00€
*
ML216
Item number: TGM-T5413-100mg
Description: ML216 (CID-49852229) is a small molecule inhibitor of BLM helicase with an IC50 of 1.8 µM, demonstrating 28-fold selectivity against the related helicases RECQ1, RECQ5, and E. coli UvrD (IC50s > 50 µM). Target: DNA/RNA Synthesis. Smiles: Fc1ccc(NC(=O)Nc2nnc(s2)-c2ccncc2)cc1C(F)(F)F. References:...
| Keywords: | CID-49852229 |
| Application: | BLM helicase inhibitor |
| CAS | 1430213-30-1 |
| MW: | 383.32 D |
From 54.00€
*