25 products were found matching "K10574"!
No results were found for the filter!
UBE2B Protein, Mouse, Recombinant
Item number: TGM-TMPY-00611-100ug
Description: The ubiquitin-conjugating enzyme E2B (Ube2b) is a critical target gene of androgen receptor (AR), mediating the function of AR in spermatogenesis by promoting H2A ubiquitylation. Moreover, UBE2B plays an important role in muscle protein homeostasis during catabolic conditions.
| Keywords: | HR6B, Rad6b, mHR6B, ubiquitin-conjugating enzyme E2B, E2-14k, 2610301N02Rik |
| MW: | 17.3 kD |
699.00€
*
UBE2B Protein, Human, Recombinant (His)
Item number: TGM-TMPJ-00033-10ug
Description: Ubiquitin-Conjugating Enzyme E2 B (UBE2B) is a member of the ubiquitin-conjugating enzyme family. UBE2B accepts ubiquitin from the E1 complex and catalyzes its covalent attachment to other proteins. It is shown that UBE2B interacts with RAD18, UBR2, and WAC. UBE2B is required for post-replicative DNA...
| Keywords: | Ubiquitin-Conjugating Enzyme E2-17 kDa, RAD6 Homolog B, hHR6B, Ubiquitin-Conjugating Enzyme E2 B, Ubiquitin-Protein Ligase... |
| MW: | 17 kD |
From 128.00€
*
TZ9
Item number: TGM-T17187-10mg
Description: TZ9 is a selective and potent Rad6 inhibitor with anticancer and anti-tumor activity.TZ9 inhibits Rad6B-induced ubiquitination of histone H2A.TZ9 induces cell cycle arrest and apoptosis. Target: Apoptosis, E1/E2/E3 Enzyme. Smiles: Nc1nc(COC(=O)c2ccc(cc2)[N+]([O-])=O)nc(Nc2ccccc2)n1. References: Sanders...
| Application: | Cell-permeable UBE2B / Rad6B inhibitor |
| CAS | 1002789-86-7 |
| MW: | 366.33 D |
From 46.00€
*
Anti-UBE2B
Item number: CSB-PA170670.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: UBE2B. Antigen Species: Human
| Keywords: | Anti-HR6B, Anti-UBE2B, Anti-RAD6B, Anti-hHR6B, Anti-RAD6 homolog B, Anti-Ubiquitin-protein ligase B, Anti-Ubiquitin... |
| Application: | ELISA, IHC |
| Host: | Rabbit |
| Species reactivity: | human, mouse, rat |
From 167.00€
*
Anti-UBE2B
Item number: CSB-PA778345.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: UBE2B. Antigen Species: Human
| Keywords: | Anti-HR6B, Anti-UBE2B, Anti-RAD6B, Anti-hHR6B, Anti-RAD6 homolog B, Anti-Ubiquitin-protein ligase B, Anti-Ubiquitin... |
| Application: | ELISA, IHC |
| Host: | Rabbit |
| Species reactivity: | human, mouse, rat |
From 167.00€
*
TZ9
Item number: Cay15964-1
TZ9 is a cell-permeable triazine compound that inhibits the human E2 ubiquitin-conjugating enzyme Rad6B. TZ9 selectively docks to the Rad6B catalytic site, inhibits Rad6B-induced histone H2A ubiquitination, downregulates intracellular beta-catenin, induces G2/M arrest and apoptosis, and inhibits proliferation and...
| Keywords: | 4-amino-6-(phenylamino)-2-(4-nitrobenzoate)-1,3,5-triazine-2-methanol |
| Application: | Cell-permeable UBE2B / Rad6B inhibitor |
| CAS | 1002789-86-7 |
| MW: | 366.3 D |
From 47.00€
*
Anti-UBE2B
Item number: ATA-HPA003875.100
Protein function: Accepts ubiquitin from the E1 complex and catalyzes its covalent attachment to other proteins. In association with the E3 enzyme BRE1 (RNF20 and/or RNF40), it plays a role in transcription regulation by catalyzing the monoubiquitination of histone H2B at 'Lys- 120' to form H2BK120ub1. H2BK120ub1...
| Keywords: | Anti-HR6B, Anti-hHR6B, Anti-RAD6B, Anti-UBE2B, Anti-RAD6 homolog B, Anti-Ubiquitin-protein ligase B, Anti-Ubiquitin... |
| Application: | ICC, ChIP |
| Host: | Rabbit |
| Species reactivity: | human |
From 358.00€
*
Anti-Ubiquitin-conjugating enzyme E2 B / UBE2B, clone...
Item number: NSJ-V9247-100UG
0.2 mg/ml in 1X PBS with 0.1 mg/ml BSA (US sourced), 0.05% sodium azide. The ubiquitin (Ub) pathway involves three sequential enzymatic steps that facilitate the conjugation of Ub and Ub-like molecules to specific protein substrates. The first step requires the ATP-dependent activation of the Ub C-terminus and the...
| Keywords: | Anti-HR6B, Anti-RAD6B, Anti-UBE2B, Anti-hHR6B, Anti-RAD6 homolog B, Anti-Ubiquitin-protein ligase B, Anti-Ubiquitin... |
| Application: | FC, IF |
| Host: | Mouse |
| Species reactivity: | human |
From 361.00€
*
Anti-Ubiquitin-conjugating enzyme E2 B / UBE2B, clone...
Item number: NSJ-V9247SAF-100UG
1 mg/ml in 1X PBS, BSA free, sodium azide free. The ubiquitin (Ub) pathway involves three sequential enzymatic steps that facilitate the conjugation of Ub and Ub-like molecules to specific protein substrates. The first step requires the ATP-dependent activation of the Ub C-terminus and the assembly of multi-Ub...
| Keywords: | Anti-HR6B, Anti-RAD6B, Anti-UBE2B, Anti-hHR6B, Anti-RAD6 homolog B, Anti-Ubiquitin-protein ligase B, Anti-Ubiquitin... |
| Application: | FC, IF |
| Host: | Mouse |
| Species reactivity: | human |
781.00€
*
Anti-UBE2B
Item number: CSB-PA025439GA01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: PBS with 0.1% Sodium Azide, 50% Glycerol, pH 7.3. -20°C, Avoid freeze / thaw cycles. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen Affinity Purified. Target Name: UBE2B. Antigen Species: Human
| Keywords: | Anti-HR6B, Anti-UBE2B, Anti-RAD6B, Anti-hHR6B, Anti-RAD6 homolog B, Anti-Ubiquitin-protein ligase B, Anti-Ubiquitin... |
| Application: | ELISA, IHC |
| Host: | Rabbit |
| Species reactivity: | human, mouse, rat |
552.00€
*
UBE2B (Vector Vector will be determined during the...
Item number: CSB-CL025439HU.10
Length: 459 Sequence: atgtcgaccc cggcccggag gaggctcatg cgggatttca agcggttaca agaggaccca cctgtgggtg tcagtggcgc accatctgaa aacaacatca tgcagtggaa tgcagttata tttggaccag aagggacacc ttttgaagat ggtactttta aactagtaat agaattttct gaagaatatc caaataaacc accaactgtt aggtttttat ccaaaatgtt tcatccaaat gtgtatgctg atggtagcat...
| Keywords: | HR6B, hHR6B, RAD6B, UBE2B, RAD6 homolog B, Ubiquitin-protein ligase B, Ubiquitin carrier protein B, E2... |
| Application: | Molecular biology, clone |
| Species reactivity: | human |
176.00€
*
UBE2B, aa1-152, Recombinant, Human (HHR6B, HR6B, RAD6B,...
Item number: U0879-89.50
UBE2B, also known as ubiquitin-conjugating enzyme E2 B, belongs to E2 ubiquitin-conjugating enzyme family. This protein catalyzes the covalent attachment of ubiquitin to other proteins, and associates to the E3 ligase RAD18 to form the UBE2B-RAD18 ubiquitin ligase complex involved in mono-ubiquitination of...
| Keywords: | HR6B, UBE2B, RAD6B, hHR6B, EC=6.3.2.19, RAD6 homolog B, Ubiquitin-protein ligase B, Ubiquitin carrier protein B,... |
| Origin: | human |
736.00€
*