37 products were found matching "K10351"!
No results were found for the filter!
NEW
Anti-MLC2 (Phospho-Ser19) Rabbit (Clone RM484
Item number: Cay42816-100
Myosin light-chain 2 (MLC2), also known as myosin regulatory light chain 2, is a subtype of MLC expressed in cardiac ventricular and skeletal slow-twitch muscles. MLC2 is composed of three calcium-binding EF-hand domains and is found in the head-stem interface of myosin with other MLC isoforms. It is phosphorylated...
| Keywords: | MLC-2v, MYL2, Myosin Light Chain 2, Myosin Regulatory Light Chain 2, RLC2, Ventricular Myosin Light Chain 2 |
| Application: | WB |
| Host: | Rabbit |
| Species reactivity: | human, mouse, rat |
512.00€
*
Aficamten
Item number: TGM-T9258-100mg
Description: Aficamten is a Next-Generation Cardiac Myosin Inhibitor for the Treatment of Hypertrophic Cardiomyopathy. Target: Others. Smiles: CCc1nc(no1)-c1ccc2[C@@H](CCc2c1)NC(=O)c1cnn(C)c1
| Application: | Targets myosin heavy chain 6/7 (MYH6_7) |
| CAS | 2364554-48-1 |
| MW: | 337.38 D |
From 67.00€
*
Myosin regulatory light chain 2, ventricular/cardiac...
Item number: CSB-EP015309MO.1
Organism: Mus musculus (Mouse). Source: E.coli. Expression Region: 2-166aa. Protein Length: Full Length of Mature Protein. Tag Info: C-terminal 6xHis-tagged. Target Protein Sequence: APKKAKKRIE GGSSNVFSMF EQTQIQEFKE AFTIMDQNRD GFIDKNDLRD TFAALGRVNV KNEEIDEMIK EAPGPINFTV FLTMFGEKLK GADPEETILN AFKVFDPEGK GSLKADYVRE...
| Keywords: | MLC-2, MLC-2v, MLC-2s/v, Myosin light chain 2, slow skeletal/ventricular muscle isoform, Myosin regulatory light chain 2,... |
| Application: | Activity not tested |
| Expressed in: | E.coli |
| Origin: | mouse |
| MW: | 25.6 kD |
From 247.00€
*
Myosin regulatory light chain 2, ventricular/cardiac...
Item number: CSB-RP100574h.1
Organism: Homo sapiens (Human). Source: E.coli. Expression Region: 8-164aa. Protein Length: Partial. Tag Info: N-terminal 6xHis-tagged. Target Protein Sequence: KRAGGANSNV FSMFEQTQIQ EFKEAFTIMD QNRDGFIDKN DLRDTFAALG RVNVKNEEID EMIKEAPGPI NFTVFLTMFG EKLKGADPEE TILNAFKVFD PEGKGVLKAD YVREMLTTQA ERFSKEEVDQ MFAAFPPDVT...
| Keywords: | MLC-2, MLC-2v, MLC-2s/v, Cardiac myosin light chain 2, Ventricular myosin light chain 2, Myosin light chain 2, slow... |
| Application: | Activity not tested |
| Expressed in: | E.coli |
| Origin: | human |
| MW: | 21.8 kD |
From 219.00€
*
Anti-MYL2
Item number: CSB-PA10059A0Rb.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, PH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: MYL2. Antigen Species: Human
| Keywords: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2,... |
| Application: | ELISA, IHC, IF |
| Host: | Rabbit |
| Species reactivity: | human |
From 167.00€
*
Anti-MYL2
Item number: CSB-PA107097.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: MYL2. Antigen Species: Human
| Keywords: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2,... |
| Application: | ELISA, WB |
| Host: | Rabbit |
| Species reactivity: | human, mouse, rat |
From 167.00€
*
Anti-MYL2
Item number: CSB-PA181376.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: MYL2. Antigen Species: Human
| Keywords: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2,... |
| Application: | ELISA, WB |
| Host: | Rabbit |
| Species reactivity: | human, mouse, rat |
From 167.00€
*
Anti-Myosin Light Chain 2, clone 3B2
Item number: ARG56986.50
Protein function: Contractile protein that plays a role in heart development and function. Following phosphorylation, plays a role in cross-bridge cycling kinetics and cardiac muscle contraction by increasing myosin lever arm stiffness and promoting myosin head diffusion, as a consequence of the increase in maximum...
| Keywords: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2,... |
| Application: | WB, FC |
| Host: | Mouse |
| Species reactivity: | human, rat |
518.00€
*
Anti-MYL2
Item number: E-AB-10476.120
Thus gene encodes the regulatory light chain associated with cardiac myosin beta (or slow) heavy chain. Ca+ triggers the phosphorylation of regulatory light chain that in turn triggers contraction. Mutations in this gene are associated with mid-left ventricular chamber type hypertrophic cardiomyopathy. Protein...
| Keywords: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2,... |
| Application: | WB, ELISA |
| Host: | Rabbit |
| Species reactivity: | human, mouse, rat |
From 89.00€
*
Anti-MYL2
Item number: E-AB-14231.120
Thus gene encodes the regulatory light chain associated with cardiac myosin beta (or slow) heavy chain. Ca+ triggers the phosphorylation of regulatory light chain that in turn triggers contraction. Mutations in this gene are associated with mid-left ventricular chamber type hypertrophic cardiomyopathy. Protein...
| Keywords: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2,... |
| Application: | WB, ELISA |
| Host: | Rabbit |
| Species reactivity: | human, mouse, rat |
From 89.00€
*
Anti-MYL2
Item number: E-AB-64950.120
Thus gene encodes the regulatory light chain associated with cardiac myosin beta (or slow) heavy chain. Ca+ triggers the phosphorylation of regulatory light chain that in turn triggers contraction. Mutations in this gene are associated with mid-left ventricular chamber type hypertrophic cardiomyopathy. Protein...
| Keywords: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2,... |
| Application: | WB |
| Host: | Rabbit |
| Species reactivity: | mouse, rat |
From 243.00€
*
Anti-MYL2
Item number: E-AB-70328.120
MYL2,also named as MLC-2v and MLC-2,is ventricular/cardiac muscle isoform. Defects in MYL2 are the cause of cardiomyopathy familial hypertrophic type 10 (CMH10). Defects in MYL2 are the cause of cardiomyopathy familial hypertrophic with mid-left ventricular chamber type 2 (MVC2). MYL2 has been widely used as a...
| Keywords: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Myosin light chain 2, slow skeletal/ventricular muscle isoform, Anti-Myosin... |
| Application: | IHC |
| Host: | Rabbit |
| Species reactivity: | mouse, rat |
From 195.00€
*