40 products were found matching "K08541"!
No results were found for the filter!
TCPOBOP
Item number: TGM-T17018-100mg
Description: TCPOBOP, a constitutive androstane receptor agonist, induces robust hepatocyte proliferation and hepatomegaly while decreasing Fas-induced murine liver injury by altering Bcl-2 proteins. Target: BCL. Smiles: Clc1cnc(Oc2ccc(Oc3ncc(Cl)cc3Cl)cc2)c(Cl)c1. References: Bhushan B, et al. TCPOBOP-Induced...
| Application: | Mouse CAR agonist |
| CAS | 76150-91-9 |
| MW: | 402.06 D |
From 45.00€
*
CITCO
Item number: TGM-T14973-100mg
Description: CITCO inhibits growth and expansion of brain tumour stem cells (BTSCs) and has an EC50 of 49 nM over pregnane X receptor (PXR), and no activity on other nuclear receptors. CITCO is an imidazothiazole derivative and it also is a selective Constitutive androstane receptor (CAR) agonist. Target: Apoptosis,...
| Application: | CAR agonist |
| CAS | 338404-52-7 |
| MW: | 436.74 D |
From 57.00€
*
Z-CITCO
Item number: TGM-T83878-10mg
Description: Z-CITCO acts as an agonist for the constitutive androstane receptor (CAR, with an EC50 of 3.9 µM in human receptor reporter assays) and is the cis isomer of the CAR agonist CITCO. Target: Others. Smiles: ClC(C=C1)=CC=C1C(N=C2N3C=CS2)=C3/C=N\OCC4=CC(Cl)=C(Cl)C=C4
| Application: | CAR agonist |
| CAS | 2583138-04-7 |
| MW: | 436.7 D |
From 75.00€
*
Nuclear receptor subfamily 1 group I member 3 (NR1I3),...
Item number: CSB-EP622930HU.1
Organism: Homo sapiens (Human). Source: E.coli. Expression Region: 2-351aa. Protein Length: Partial. Tag Info: N-terminal 6xHis-SUMO-tagged. Target Protein Sequence: ASREDELRNC VVCGDQATGY HFNALTCEGC KGFFRRTVSK SIGPTCPFAG SCEVSKTQRR HCPACRLQKC LDAGMRKDMI LSAEALALRR AKQAQRRAQQ TPVQLSKEQE ELIRTLLGAH TRHMGTMFEQ...
| Keywords: | CAR, NR1I3, Orphan nuclear receptor MB67, Constitutive active response, Constitutive androstane receptor, Constitutive... |
| Application: | Activity not tested |
| Expressed in: | E.coli |
| Origin: | human |
| MW: | 55.7 kD |
From 219.00€
*
Anti-NR1I3
Item number: CSB-PA13019A0Rb.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, PH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: NR1I3. Antigen Species: Human
| Keywords: | Anti-CAR, Anti-NR1I3, Anti-Constitutive active response, Anti-Orphan nuclear receptor MB67, Anti-Constitutive androstane... |
| Application: | ELISA, IHC |
| Host: | Rabbit |
| Species reactivity: | human |
From 167.00€
*
Anti-NR1I3
Item number: CSB-PA586225.100
Host Species: Rabbit. Isotype: IgG. Buffer: Rabbit IgG in phosphate buffered saline (without Mg2+ and Ca2+), pH 7.4, 150mM NaCl, 0.02% sodium azide and 50% glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: The antibody was affinity-purified from rabbit antiserum by...
| Keywords: | Anti-CAR, Anti-NR1I3, Anti-Constitutive active response, Anti-Orphan nuclear receptor MB67, Anti-Constitutive androstane... |
| Application: | ELISA, WB |
| Host: | Rabbit |
| Species reactivity: | human |
283.00€
*
TCPOBOP
Item number: Cay14140-5
The mouse constitutive androstane receptor (mCAR), with the retinoid X receptor, binds to the retinoic acid response element to upregulate the expression of proteins that metabolize xenobiotics. TCPOBOP is an agonist for mCAR (EC50 = 20 nM) that is effective for the mouse receptor but not for human or rat CAR...
| Keywords: | 2,2'-[1,4-phenylenebis(oxy)]bis[3,5-dichloro]-pyridine |
| Application: | Mouse CAR agonist |
| CAS | 76150-91-9 |
| MW: | 402.1 D |
From 61.00€
*
CITCO
Item number: Cay16027-10
CITCO is an agonist of human CAR (EC50 = 49 nM). It induces nuclear translocation of human CAR in hepatocytes, followed by increased expression of CAR-regulated genes, including several cytochrome P450 isoforms. CITCO less potently activates human pregnane X receptor (EC50 = 3 µM) and has no detectable activity on...
| Keywords: | O-[(3,4-dichlorophenyl)methyl]oxime 6-(4-chlorophenyl)-imidazo[2,1-b]thiazole-5-carboxaldehyde |
| Application: | CAR agonist |
| CAS | 338404-52-7 |
| MW: | 436.7 D |
From 99.00€
*
CINPA1
Item number: Cay29110-1
CINPA1 is a constitutive androstane receptor (CAR) antagonist (IC50 = 70 nM in a reporter assay). It is selective for CAR over the nuclear receptors GR, FXR, LXRalpha, LXRbeta, PPARgamma, RXRalpha, and RXRbeta at 18 µM, but also antagonizes the human pregnane X receptor (PXR, IC50 = 6.6 µM). CINPA1 (0.3-5 µM)...
| Keywords: | [5-[(diethylamino)acetyl]-10,11-dihydro-5H-dibenz[b,f]azepin-3-yl]-carbamic acid, ethyl ester |
| Application: | Constitutive androstane receptor (CAR) antagonist |
| CAS | 102636-74-8 |
| MW: | 395.5 D |
From 44.00€
*
Anti-NR1I3
Item number: ARG57440.100
Protein function: Binds and transactivates the retinoic acid response elements that control expression of the retinoic acid receptor beta 2 and alcohol dehydrogenase 3 genes. Transactivates both the phenobarbital responsive element module of the human CYP2B6 gene and the CYP3A4 xenobiotic response element. [The...
| Keywords: | Anti-CAR, Anti-NR1I3, Anti-Constitutive active response, Anti-Orphan nuclear receptor MB67, Anti-Constitutive androstane... |
| Application: | ICC, IF, IHC (paraffin), WB |
| Host: | Rabbit |
| Species reactivity: | human, mouse, rat |
658.00€
*
Human CAR / NR1I3 ELISA Kit
Item number: G-HUFI01793.96
| Application: | ELISA |
| Species reactivity: | human |
641.00€
*
Mouse CAR / NR1I3 ELISA Kit
Item number: G-MOFI00541.96
| Application: | ELISA |
| Species reactivity: | mouse |
694.00€
*