154 products were found matching "K06643"!
No results were found for the filter!
(±)-Nutlin-3
Item number: Cay10004372-5
(±)-Nutlin-3 is a racemic mixture of the p53-Mdm2 protein-protein interaction inhibitor (-)-nutlin-3 (Cay-18585) and its less active enantiomer (+)-nutlin-3 (Cay-10009816). In vivo, (±)-nutlin-3 (200 mg/kg twice daily) reduces tumor volume in an SJSA-1 osteosarcoma mouse xenograft model.Formal Name:...
| Keywords: | rel-4-[[(4R,5S)-4,5-bis(4-chlorophenyl)-4,5-dihydro-2-[4-methoxy-2-(1-methylethoxy)phenyl]-1H-imidazol-1-yl]carbonyl]-2-pi... |
| Application: | Cell cycle arrest promotor |
| CAS | 548472-68-0 |
| MW: | 581.5 D |
From 52.00€
*
Anti-MDM2
Item number: ABS-KC-1054.100
Protein function: E3 ubiquitin-protein ligase that mediates ubiquitination of p53/TP53, leading to its degradation by the proteasome. Inhibits p53/TP53- and p73/TP73-mediated cell cycle arrest and apoptosis by binding its transcriptional activation domain. Also acts as a ubiquitin ligase E3 toward itself and ARRB1....
| Keywords: | Anti-E3 ubiquitin-protein ligase Mdm2, Anti-Double minute 2 protein, Anti-Hdm2, Anti-Oncoprotein Mdm2, Anti-RING-type E3... |
| Application: | IHC |
| Host: | Mouse |
| Species reactivity: | human |
From 206.00€
*
Anti-MDM2
Item number: ABS-KC-1055.100
Protein function: E3 ubiquitin-protein ligase that mediates ubiquitination of p53/TP53, leading to its degradation by the proteasome. Inhibits p53/TP53- and p73/TP73-mediated cell cycle arrest and apoptosis by binding its transcriptional activation domain. Also acts as a ubiquitin ligase E3 toward itself and ARRB1....
| Keywords: | Anti-E3 ubiquitin-protein ligase Mdm2, Anti-Double minute 2 protein, Anti-Hdm2, Anti-Oncoprotein Mdm2, Anti-RING-type E3... |
| Host: | Mouse |
| Species reactivity: | human |
From 232.00€
*
Anti-MDM2
Item number: ABS-KC-1056.100
Protein function: E3 ubiquitin-protein ligase that mediates ubiquitination of p53/TP53, leading to its degradation by the proteasome. Inhibits p53/TP53- and p73/TP73-mediated cell cycle arrest and apoptosis by binding its transcriptional activation domain. Also acts as a ubiquitin ligase E3 toward itself and ARRB1....
| Keywords: | Anti-E3 ubiquitin-protein ligase Mdm2, Anti-Double minute 2 protein, Anti-Hdm2, Anti-Oncoprotein Mdm2, Anti-RING-type E3... |
| Application: | IHC |
| Host: | Mouse |
| Species reactivity: | human |
From 206.00€
*
Anti-MDM2 (phospho S166)
Item number: ABS-KC-2243.100
Protein function: E3 ubiquitin-protein ligase that mediates ubiquitination of p53/TP53, leading to its degradation by the proteasome. Inhibits p53/TP53- and p73/TP73-mediated cell cycle arrest and apoptosis by binding its transcriptional activation domain. Also acts as a ubiquitin ligase E3 toward itself and ARRB1....
| Keywords: | Anti-E3 ubiquitin-protein ligase Mdm2, Anti-Double minute 2 protein, Anti-Hdm2, Anti-Oncoprotein Mdm2, Anti-RING-type E3... |
| Application: | IHC |
| Host: | Mouse |
| Species reactivity: | human |
From 206.00€
*
Anti-MDM2 (phospho S166)
Item number: ABS-KC-2244.100
Protein function: E3 ubiquitin-protein ligase that mediates ubiquitination of p53/TP53, leading to its degradation by the proteasome. Inhibits p53/TP53- and p73/TP73-mediated cell cycle arrest and apoptosis by binding its transcriptional activation domain. Also acts as a ubiquitin ligase E3 toward itself and ARRB1....
| Keywords: | Anti-E3 ubiquitin-protein ligase Mdm2, Anti-Double minute 2 protein, Anti-Hdm2, Anti-Oncoprotein Mdm2, Anti-RING-type E3... |
| Application: | IHC |
| Host: | Mouse |
| Species reactivity: | human |
From 206.00€
*
MDM2 (human), recombinant protein
Item number: ABS-PP-364.20
| Keywords: | E3 ubiquitin-protein ligase Mdm2, Double minute 2 protein, Hdm2, Oncoprotein Mdm2, RING-type E3 ubiquitin transferase... |
| Expressed in: | E.coli |
| Origin: | human |
| MW: | 29 kD |
From 90.00€
*
(-)-Nutlin-3
Item number: Cay18585-1
(-)-Nutlin-3 is an inhibitor of the protein-protein interaction between p53 and Mdm2 (IC50 = 0.09 µM). It increases p53 levels, induces apoptosis, and reduces cell viability in HCT116, SJSA-1, and RKO cells that express wild-type p53 but not MDA-MB-435 or SW480 cells expressing mutant p53. (-)-Nutlin-3 (200 mg/kg)...
| Keywords: | Nutlin 3a,... |
| Application: | Mdm2-p53 binding inhibitor |
| CAS | 675576-98-4 |
| MW: | 581.5 D |
From 128.00€
*
DS-3032
Item number: Cay41838-1
DS-3032 is an inhibitor of the protein-protein interaction between murine double minute 2 (MDM2) and p53. It induces apoptosis in WaGa and PeTa Merkel cell carcinoma cells when used at a concentration of 100 nM. DS-3032 (1 µM) decreases the viability of p53 wild-type MKL-1 cells but not p53 knockout MLK-1 cells. In...
| Keywords: | DS-3032b, Milademetan, RAIN-32,... |
| Application: | MDM2-p53 protein-protein interaction inhibitor |
| CAS | 1398568-47-2 |
| MW: | 618.5 D |
From 217.00€
*
Nutlin-3a
Item number: TGM-T6023-1mg
Description: Nutlin-3a ((-)-Nutlin-3), the active enantiomer of Nutlin-3, inhibits MDM2-p53 interactions and stabilizes the p53 protein. Target: Autophagy, Apoptosis, E1/E2/E3 Enzyme. Smiles: COc1ccc(C2=N[C@H]([C@H](N2C(=O)N2CCNC(=O)C2)c2ccc(Cl)cc2)c2ccc(Cl)cc2)c(OC(C)C)c1. References: Tovar C, et al. Proc Natl...
| Keywords: | Nutlin-3a chiral, (-)-Nutlin-3, (-)-Nutlin-3 |
| Application: | Mdm2-p53 binding inhibitor |
| CAS | 675576-98-4 |
| MW: | 581.49 D |
From 45.00€
*
MMRi62
Item number: TGM-T60202-100mg
Description: MMRi62 (7-[(2,3-dichlorophenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol), a ferroptosis inducer targeting MDM2-MDM4 (negative regulators of tumor suppressor p53). MMRi62 shows a P53-independent pro-apoptotic activity against pancreatic ductal adenocarcinoma (PDAC) cells and induce autophagy. MMRi62...
| Keywords: | 7-[(2,3-dichlorophenyl)-(pyridin-2-ylamino)methyl]quinolin-8-ol |
| Application: | MDM2 / MDM4 degrader |
| CAS | 352693-80-2 |
| MW: | 396.27 D |
From 31.00€
*
Idasanutlin
Item number: TGM-T6254-100mg
Description: Idasanutlin (Ro 5503781) (RG-7388) is an effective and specific p53-MDM2 inhibitor (IC50: 6 nM). Target: E1/E2/E3 Enzyme, Mdm2. Smiles: COc1cc(ccc1NC(=O)C1NC(CC(C)(C)C)C(C#N)(C1c1cccc(Cl)c1F)c1ccc(Cl)cc1F)C(O)=O. References: Ding Q, et al. J Med Chem. 2013, 56(14), 5979-5983.
| Keywords: | Ro 5503781, RG7388 |
| Application: | Targets E3 ubiquitin-protein ligase Mdm2 [EC:2.3.2.27] (MDM2) |
| CAS | 1229705-06-9 |
| MW: | 616.48 D |
From 34.00€
*