108 products were found matching "K05625"!
No results were found for the filter!
NEW
TG53
Item number: Cay42514-10
TG53 is an inhibitor of the protein-protein interaction between transglutaminase 2 (TG2) and fibronectin (IC50 = 10 µM in a cell-free assay). It inhibits the adhesion of SKOV3 ovarian cancer cells to fibronectin-coated wells when used at a concentration of 25 µM. TG53 (10 µM) inhibits migration and invasion in a...
| Keywords: | 5-chloro-N-[4-[[4-(dimethylamino)-6-methyl-2-pyrimidinyl]amino]phenyl]-2-methoxy-benzamide |
| Application: | TG2-fibronectin protein-protein interaction inhibitor |
| CAS | 946369-04-6 |
| MW: | 411.88 D |
From 109.00€
*
ZED-1227
Item number: Cay42333-1
ZED-1227 is an inhibitor of transglutaminase 2 (TG2, IC50 = 0. µM). It is selective for TG2 over TG1, TG3, TG6, and Factor XIIIa2 (IC50s = 24. >50, 6. and >50 µM, respectively).InChI:...
| Keywords: | TAK-227,... |
| Application: | Transglutaminase 2 (TGM2) inhibitor |
| CAS | 1542132-88-6 |
| MW: | 528.6 D |
From 244.00€
*
BJJF078
Item number: Cay42397-1
BJJF078 is an inhibitor of transglutaminase 2 (TG2, IC50s = 41 and 54 nM for the human and mouse enzymes, respectively). It is selective for TG2 over Factor XII (IC50 = 22 µM for the human enzyme) but does inhibit TG1 (IC50 = 0. µM for the human enzyme).InChI:...
| Keywords: | 3,4-dimethoxy-N-[5-[[4-[(1-oxo-2-propen-1-yl)amino]-1-piperidinyl]sulfonyl]-1-naphthalenyl]-benzamide |
| Application: | Transglutaminase 2 (TGM2) inhibitor |
| CAS | 2531244-56-9 |
| MW: | 523.6 D |
From 35.00€
*
Anti-TGM2
Item number: ABS-KC-1373.100
Protein function: Catalyzes the cross-linking of proteins, such as WDR54, and the conjugation of polyamines to proteins. [The UniProt Consortium]
| Keywords: | Anti-Protein-glutamine gamma-glutamyltransferase 2, Anti-Erythrocyte transglutaminase, Anti-Heart G alpha(h), Anti-hhG... |
| Host: | Mouse |
| Species reactivity: | human |
From 232.00€
*
Anti-TGM2
Item number: ABS-KC-1463.100
Protein function: Catalyzes the cross-linking of proteins, such as WDR54, and the conjugation of polyamines to proteins. [The UniProt Consortium]
| Keywords: | Anti-Protein-glutamine gamma-glutamyltransferase 2, Anti-Erythrocyte transglutaminase, Anti-Heart G alpha(h), Anti-hhG... |
| Application: | IHC |
| Host: | Mouse |
| Species reactivity: | human |
From 206.00€
*
Anti-TGM2
Item number: ABS-KC-1600.100
Protein function: Catalyzes the cross-linking of proteins, such as WDR54, and the conjugation of polyamines to proteins. [The UniProt Consortium]
| Keywords: | Anti-Protein-glutamine gamma-glutamyltransferase 2, Anti-Erythrocyte transglutaminase, Anti-Heart G alpha(h), Anti-hhG... |
| Application: | IHC |
| Host: | Mouse |
| Species reactivity: | human |
From 206.00€
*
Anti-TGM2
Item number: ABS-KC-1725.100
Protein function: Catalyzes the cross-linking of proteins, such as WDR54, and the conjugation of polyamines to proteins. [The UniProt Consortium]
| Keywords: | Anti-Protein-glutamine gamma-glutamyltransferase 2, Anti-Erythrocyte transglutaminase, Anti-Heart G alpha(h), Anti-hhG... |
| Application: | IP |
| Host: | Mouse |
| Species reactivity: | human |
From 206.00€
*
Anti-TGM2
Item number: ABS-KC-1726.100
Protein function: Catalyzes the cross-linking of proteins, such as WDR54, and the conjugation of polyamines to proteins. [The UniProt Consortium]
| Keywords: | Anti-Protein-glutamine gamma-glutamyltransferase 2, Anti-Erythrocyte transglutaminase, Anti-Heart G alpha(h), Anti-hhG... |
| Application: | IP |
| Host: | Mouse |
| Species reactivity: | human |
From 206.00€
*
Anti-TGM2
Item number: ABS-KC-949.100
Protein function: Catalyzes the cross-linking of proteins, such as WDR54, and the conjugation of polyamines to proteins. [The UniProt Consortium]
| Keywords: | Anti-Protein-glutamine gamma-glutamyltransferase 2, Anti-Erythrocyte transglutaminase, Anti-Heart G alpha(h), Anti-hhG... |
| Application: | IHC |
| Host: | Mouse |
| Species reactivity: | human |
From 206.00€
*
Anti-TGM2
Item number: ABS-OC-143.100
Protein function: Catalyzes the cross-linking of proteins, such as WDR54, and the conjugation of polyamines to proteins. [The UniProt Consortium]
| Keywords: | Anti-Protein-glutamine gamma-glutamyltransferase 2, Anti-Erythrocyte transglutaminase, Anti-Heart G alpha(h), Anti-hhG... |
| Application: | IHC |
| Host: | Mouse |
| Species reactivity: | human |
From 206.00€
*
TGM2 (human), recombinant protein
Item number: ABS-PP-221.20
| Keywords: | Protein-glutamine gamma-glutamyltransferase 2, Erythrocyte transglutaminase, Heart G alpha(h), hhG alpha(h), Isopeptidase... |
| Expressed in: | E.coli |
| Origin: | human |
| MW: | 12 kD |
From 90.00€
*
AA9 TG2 inhibitor
Item number: TGM-T69878-100mg
Description: AA9 is a novel transglutaminase (TG2) inhibitor. Target: Others. Smiles: C(=O)(C=1C2=C(C=CC1)C=CC=C2)N3CCN(C([C@@H](NC(OCC4=CC=CC=C4)=O)CCCCNC(C=C)=O)=O)CC3
| Application: | Transglutaminase 2 (TG2) inhibitor |
| CAS | 2134114-20-6 |
| MW: | 556.65 D |
From 1,671.00€
*