28 products were found matching "K05011"!
No results were found for the filter!
Anti-Recombinant ClC-2, clone A430
Item number: E-AN301722L.100
ClC-2 (chloride channel protein 2) is a transmembrane protein and functions as a voltage-gated chloride channel. Chloride channels have several functions including the regulation of cell volume, membrane potential stabilization, signal transduction and transepithelial transport. ClC-2 is highly expressed in adrenal...
| Keywords: | Anti-CLCN2, Anti-Chloride channel protein 2, Recombinant ClC-2 Monoclonal Antibody |
| Application: | WB, IHC |
| Host: | Rabbit |
| Species reactivity: | human, rat, mouse |
From 304.00€
*
Anti-CLCN2, Internal
Item number: ARG65190.100
Protein function: Voltage-gated chloride channel. Chloride channels have several functions including the regulation of cell volume, membrane potential stabilization, signal transduction and transepithelial transport. [The UniProt Consortium]
| Keywords: | Anti-CLCN2, Anti-ClC-2, Anti-Chloride channel protein 2 |
| Application: | ELISA, WB |
| Host: | Goat |
| Species reactivity: | human |
871.00€
*
Anti-CLCN2
Item number: NSJ-R35412-100UG
0.5 mg/ml in 1X TBS, pH7.3, with 0.5% BSA (US sourced) and 0.02% sodium azide. Additional name(s) for this target protein: Chloride channel 2 Protein function: Voltage-gated chloride channel. Chloride channels have several functions including the regulation of cell volume, membrane potential stabilization, signal...
| Keywords: | Anti-CLCN2, Anti-ClC-2, Anti-Chloride channel protein 2, CLCN2 Antibody |
| Application: | WB, ELISA (peptide) |
| Host: | Goat |
| Species reactivity: | human |
836.00€
*
Lubiprostone
Item number: Cay10010487-10
Lubiprostone is an activator of chloride channel protein 2 (ClC-2) and a bicyclic derivative of prostaglandin E1 (PGE1, Cay-13010). It induces chloride currents in HEK293 cells expressing recombinant human ClC-2 (EC50 = ~17 nM), but not CFTR, chloride channels. Lubiprostone (1 µM) induces short-circuit currents, a...
| Keywords: | RU-0211, SPI-0211, 16,16-difluoro-11alpha-hydroxy-9,15-dioxo-prostan-1-oic acid |
| Application: | ClC-2 activator |
| CAS | 136790-76-6 |
| MW: | 390.5 D |
From 93.00€
*
Anti-CLCN2
Item number: ATA-HPA014545.100
Protein function: Voltage-gated chloride channel. Chloride channels have several functions including the regulation of cell volume, membrane potential stabilization, signal transduction and transepithelial transport. Involved in the regulation of aldosterone production. The opening of CLCN2 channels at...
| Keywords: | Anti-CLCN2, Anti-ClC-2, Anti-Chloride channel protein 2 |
| Application: | ICC, IHC |
| Host: | Rabbit |
| Species reactivity: | human |
From 369.00€
*
Anti-CLCN2
Item number: ATA-HPA024108.100
Protein function: Voltage-gated chloride channel. Chloride channels have several functions including the regulation of cell volume, membrane potential stabilization, signal transduction and transepithelial transport. Involved in the regulation of aldosterone production. The opening of CLCN2 channels at...
| Keywords: | Anti-CLCN2, Anti-ClC-2, Anti-Chloride channel protein 2 |
| Application: | IHC |
| Host: | Rabbit |
| Species reactivity: | human |
From 369.00€
*
Lubiprostone
Item number: TGM-T6307-100mg
Description: Lubiprostone (RU-0211), an activator of ClC-2 chloride channels, is used in the therapy of idiopathic chronic constipation. Target: Chloride channel. Smiles: CCCCC(F)(F)C(=O)CC[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(O)=O. References: Bijvelds MJ, et al. Gastroenterology, 2009, 137(3), 976-1985.
| Keywords: | RU-0211, SPI-0211 |
| Application: | ClC-2 activator |
| CAS | 136790-76-6 |
| MW: | 390.46 D |
From 45.00€
*
Anti-CLCN2
Item number: ARG45963.100
Protein function: Voltage-gated chloride channel. Chloride channels have several functions including the regulation of cell volume, membrane potential stabilization, signal transduction and transepithelial transport. Involved in the regulation of aldosterone production. The opening of CLCN2 channels at...
| Keywords: | Anti-CLCN2, Anti-ClC-2, Anti-ClC-2, Anti-Chloride channel protein 2, Anti-Chloride channel protein 2 |
| Application: | ICC, IF, IHC (paraffin), WB |
| Host: | Rabbit |
| Species reactivity: | human, mouse, rat |
740.00€
*
CLCN2 (human), recombinant protein
Item number: ABS-PP-4443-L.100
Protein function: Voltage-gated chloride channel. Chloride channels have several functions including the regulation of cell volume, membrane potential stabilization, signal transduction and transepithelial transport. Involved in the regulation of aldosterone production. The opening of CLCN2 channels at...
| Keywords: | Chloride channel protein 2, ClC-2, Recombinant Human CLCN2 Protein |
| Expressed in: | E.coli |
| Origin: | human |
| MW: | 40 kD |
From 115.00€
*
Anti-clh-3
Item number: CSB-PA190466XA01CXY.100
Make to order. Production time: 70-80 business days. Deliverables: 1. 200 µg antigen (used as positive control), 2. 1 ml pre-immune serum (used as negative control) , 3. Rabbit polyclonal antibody, antigen affinity purified. Quality Guarantee: 1. Antibody purity > 90% confirmed by SDS-PAGE, 2. Antibody titer > 1:...
| Keywords: | Anti-Chloride channel protein clh-3, clh-3 Antibody |
| Application: | ELISA, WB |
| Host: | Rabbit |
| Species reactivity: | Caenorhabditis elegans |
From 1,529.00€
*
Anti-Clcn2
Item number: CSB-PA005481XA01RA.100
Make to order. Production time: 70-80 business days. Deliverables: 1. 200 µg antigen (used as positive control), 2. 1 ml pre-immune serum (used as negative control) , 3. Rabbit polyclonal antibody, antigen affinity purified. Quality Guarantee: 1. Antibody purity > 90% confirmed by SDS-PAGE, 2. Antibody titer > 1:...
| Keywords: | Anti-Clcn2, Anti-ClC-2, Anti-Chloride channel protein 2, Clcn2 Antibody |
| Application: | ELISA, WB |
| Host: | Rabbit |
| Species reactivity: | Rattus norvegicus (Rat) |
From 1,529.00€
*
Anti-ClC-a
Item number: CSB-PA894220XA01DLU.100
Make to order. Production time: 70-80 business days. Deliverables: 1. 200 µg antigen (used as positive control), 2. 1 ml pre-immune serum (used as negative control) , 3. Rabbit polyclonal antibody, antigen affinity purified. Quality Guarantee: 1. Antibody purity > 90% confirmed by SDS-PAGE, 2. Antibody titer > 1:...
| Keywords: | Anti-ClC-2, Anti-ClC-a, Anti-DmClC-2, Anti-CG31116, Anti-Chloride channel-a, Anti-Chloride channel protein 2, ClC-a Antibody |
| Application: | ELISA, WB |
| Host: | Rabbit |
| Species reactivity: | Drosophila melanogaster (Fruit fly) |
From 1,529.00€
*