36 products were found matching "K04977"!

Protein function: Isoform 1: Nonselective, voltage-independent cation channel that mediates Na(+) and Ca(2+) influx, leading to increased cytoplasmic Ca(2+) levels (PubMed:11960981, PubMed:12594222, PubMed:11385575, PubMed:11509734, PubMed:11804595, PubMed:15561722, PubMed:16601673, PubMed:19171771, PubMed:20660597,...

N-(p-amylcinnamoyl) Anthranilic acid (ACA) is a channel blocker that acts on several transient receptor potential (TRP) channels, including TRPM2, TRPM8, and TRPC6 (IC50 = 1.7, 3.8, and 2.3 µM, respectively). It is a weak inhibitor of TRPV1. ACA is also an inhibitor of phospholipase A2, blocking the release of...

Cyclic ADP-ribose (cADP-ribose) is an endogenous metabolite of NAD+ that mobilizes the release of stored Ca2+ in the endoplasmic reticulum via ryanodine receptors in various cell types.{12737, 11940, 20368, 34320, 34319} This second messenger is generated via the cADP-ribose synthases CD38 and CD157.{20368, 34319,...

Description: N-(p-amylcinnamoyl) Anthranilic Acid (ACA) is a broad-spectrum Phospholipase A2 (PLA2) inhibitor and a TRP channel blocker. Target: TRP/TRPV Channel, Phospholipase. Smiles: CCCCCc1ccc(\C=C\C(=O)Nc2ccccc2C(O)=O)cc1. References: Kraft R, et al. Inhibition of TRPM2 cation channels by...

Protein function: Isoform 1: Nonselective, voltage-independent cation channel that mediates Na(+) and Ca(2+) influx, leading to increased cytoplasmic Ca(2+) levels (PubMed:11960981, PubMed:12594222, PubMed:11385575, PubMed:11509734, PubMed:11804595, PubMed:15561722, PubMed:16601673, PubMed:19171771, PubMed:20660597,...

Protein function: Isoform 1: Nonselective, voltage-independent cation channel that mediates Na(+) and Ca(2+) influx, leading to increased cytoplasmic Ca(2+) levels (PubMed:11960981, PubMed:12594222, PubMed:11385575, PubMed:11509734, PubMed:11804595, PubMed:15561722, PubMed:16601673, PubMed:19171771, PubMed:20660597,...

Protein function: [Isoform 1]: Nonselective, voltage-independent cation channel that mediates Na(+) and Ca(2+) influx, leading to increased cytoplasmic Ca(2+) levels (PubMed:11960981, PubMed:12594222, PubMed:11385575, PubMed:11509734, PubMed:11804595, PubMed:15561722, PubMed:16601673, PubMed:19171771,...

Protein function: [Isoform 1]: Nonselective, voltage-independent cation channel that mediates Na(+) and Ca(2+) influx, leading to increased cytoplasmic Ca(2+) levels (PubMed:11960981, PubMed:12594222, PubMed:11385575, PubMed:11509734, PubMed:11804595, PubMed:15561722, PubMed:16601673, PubMed:19171771,...

0.5mg/ml if reconstituted with 0.2ml sterile DI water. Transient receptor potential cation channel subfamily M member 2 (TRPM2), also known as Estrogen-responsive element-associated gene 1 (EREG1), is a protein that in humans is encoded by the TRPM2 gene. Using a cosmid/BAC contig, this gene is mapped to chromosome...

2'-Deoxyadenosine-5'-O-diphosphoribose is a transient receptor potential melastatin 2 (TRPM2) agonist. It increases calcium-induced currents in an inside-out patch clamp assay using HEK293 cells expressing human TRPM2 when used at a concentration of 30 µM. 2'-Deoxyadenosine-5'-O-diphosphoribose has been found in...

2'-deoxy NAD+ is a transient receptor potential melastatin 2 (TRPM2) agonist. It increases calcium-induced currents in an inside-out patch clamp assay using HEK293 cells expressing human TRPM2 when used at a concentration of 30 µM. 2'-deoxy NAD+ has been found in Jurkat T cells. It also is a substrate of...

Tat-M2NX is a peptide antagonist of transient receptor potential melastatin 2 (TRPM2). It inhibits hydrogen peroxide-induced calcium influx in HEK293 cells expressing human TRPM2 when used at concentrations ranging from 25 to 100 µM. In vivo, Tat-M2NX (20 mg/kg) reduces brain infarct volume in male, but not female,...