21 products were found matching "K03240"!
No results were found for the filter!
Anti-EIF2B5
Item number: ATA-HPA035100.100
Rabbit Polyclonal EIF2B5 Antibody against Human eukaryotic translation initiation factor 2B subunit epsilon. Validated for Western Blot. Buffer: 40% glycerol and PBS (pH 7.2). 0.02% sodium azide is added as preservative. Interspecies information: Highest antigen sequence indentity to the following orthologs:...
| Keywords: | Anti-EIF2B5, Anti-EIF2BE, Anti-eIF-2B GDP-GTP exchange factor subunit epsilon, Anti-Translation initiation factor eIF-2B... |
| Application: | WB |
| Host: | Rabbit |
| Species reactivity: | human |
From 369.00€
*
Anti-eIF2B5
Item number: A302-556A
Protein function: Catalyzes the exchange of eukaryotic initiation factor 2-bound GDP for GTP. [The UniProt Consortium]
| Keywords: | Anti-EIF2B5, Anti-EIF2BE, Anti-eIF-2B GDP-GTP exchange factor subunit epsilon, Anti-Translation initiation factor eIF-2B... |
| Application: | WB, IP, IHC |
| Host: | Rabbit |
| Species reactivity: | human |
From 165.00€
*
Anti-eIF2B5
Item number: A302-557A
Protein function: Catalyzes the exchange of eukaryotic initiation factor 2-bound GDP for GTP. [The UniProt Consortium]
| Keywords: | Anti-EIF2B5, Anti-EIF2BE, Anti-eIF-2B GDP-GTP exchange factor subunit epsilon, Anti-Translation initiation factor eIF-2B... |
| Application: | WB, IP, IHC |
| Host: | Rabbit |
| Species reactivity: | human |
From 165.00€
*
Anti-eIF2B5 (IHC)
Item number: IHC-00709
Protein function: Catalyzes the exchange of eukaryotic initiation factor 2-bound GDP for GTP. [The UniProt Consortium]
| Keywords: | Anti-EIF2B5, Anti-EIF2BE, Anti-eIF-2B GDP-GTP exchange factor subunit epsilon, Anti-Translation initiation factor eIF-2B... |
| Application: | IHC |
| Host: | Rabbit |
| Species reactivity: | human |
From 165.00€
*
Anti-EIF2B5
Item number: ATA-HPA064370.100
Protein function: Catalyzes the exchange of eukaryotic initiation factor 2- bound GDP for GTP. [The UniProt Consortium] Buffer: 40% glycerol and PBS (pH 7.2). 0.02% sodium azide is added as preservative. Highest antigen sequence identity to mouse: 90% and to rat: 88%
| Keywords: | Anti-EIF2BE, Anti-EIF2B5, Anti-eIF-2B GDP-GTP exchange factor subunit epsilon, Anti-Translation initiation factor eIF-2B... |
| Application: | ICC |
| Host: | Rabbit |
| Species reactivity: | human |
From 246.00€
*
Anti-EIF2B5
Item number: ATA-HPA069303.100
Protein function: Catalyzes the exchange of eukaryotic initiation factor 2- bound GDP for GTP. [The UniProt Consortium] Buffer: 40% glycerol and PBS (pH 7.2). 0.02% sodium azide is added as preservative. Highest antigen sequence identity to mouse: 84% and to rat: 89%
| Keywords: | Anti-EIF2BE, Anti-EIF2B5, Anti-eIF-2B GDP-GTP exchange factor subunit epsilon, Anti-Translation initiation factor eIF-2B... |
| Application: | ICC |
| Host: | Rabbit |
| Species reactivity: | human |
From 246.00€
*
2BAct
Item number: TGM-T9149-100mg
Description: 2BAct is a novel eif2b activator, preventing neurological defects caused by a chronic integrated stress response. Target: PERK. Smiles: FC(F)c1cnc(cn1)C(=O)NC12CC(C1)(C2)NC(=O)COc1ccc(Cl)c(F)c1. References: Wong YL, LeBon L, Basso AM, Kohlhaas KL, Nikkel AL, Robb HM, Donnelly-Roberts DL, Prakash J,...
| Keywords: | 2B-Act, 2B Act |
| Application: | EIF2B activator |
| CAS | 2143542-28-1 |
| MW: | 440.8 D |
From 50.00€
*
DNL343
Item number: Cay41674-1
DNL343 is an activator of eukaryotic translation initiation factor 2B (eIF2B, IC50 = 9.8 nM in a reporter assay) and a derivative of 2BAct (Cay-37788). It inhibits sodium arsenite-induced formation of stress granules positive for TAR DNA-binding protein 43 (TDP-43) in an in vitro model of amyotrophic lateral...
| Keywords: | 2-(4-chlorophenoxy)-N-[3-[5-[cis-3-(trifluoromethoxy)cyclobutyl]-1,3,4-oxadiazol-2-yl]bicyclo[1.1.1]pent-1-yl]-acetamide |
| Application: | EIF2B activator |
| CAS | 2278265-85-1 |
| MW: | 457.8 D |
From 127.00€
*
NEW
![Anti-eIF2B5 [R05-6P8] Monoclonal Antibody](/custom/plugins/NetiThemeBiomol/Resources/Themes/Frontend/Biomol/frontend/_public/src/img/no-picture.jpg "Anti-eIF2B5 [R05-6P8] Monoclonal Antibody")
Anti-eIF2B5 [R05-6P8] Monoclonal Antibody
Item number: G-AGMB03024.20
eIF2B5 Monoclonal Antibody from Assay Genie is a high quality antibody for research use only. Protein Function: Acts as a component of the translation initiation factor 2B (eIF2B) complex, which catalyzes the exchange of GDP for GTP on eukaryotic initiation factor 2 (eIF2) gamma subunit (PubMed:25858979,...
| Keywords: | Anti-EIF2B5, Anti-eIF2B GDP-GTP exchange factor subunit epsilon, Anti-Translation initiation factor eIF2B subunit epsilon |
| Application: | WB, IHC-P, ICC/IF |
| Host: | Rabbit |
| Species reactivity: | human |
134.00€
*
2BAct
Item number: Cay37788-1
2BAct is an activator of eukaryotic translation initiation factor 2B (eIF2B, EC50 = 33 nM in a reporter assay). It enhances eIF2B activity in primary fibroblasts isolated from Eif2b5R191H mutant (R191H) mouse embryos (EC50 = 7.3 nM), a model of vanishing white matter (VWM) leukodystrophy. In vivo, 2BAct (30 mg/kg)...
| Keywords: | N-[3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]bicyclo[1.1.1]pent-1-yl]-5-(difluoromethyl)-2-pyrazinecarboxamide |
| Application: | EIF2B activator |
| CAS | 2143542-28-1 |
| MW: | 440.8 D |
From 116.00€
*
Anti-eIF2B5, recombinant antibody
Item number: ABS-RC-15839.100
Protein function: Catalyzes the exchange of eukaryotic initiation factor 2- bound GDP for GTP. [The UniProt Consortium]
| Keywords: | Anti-EIF2B5, Anti-EIF2BE, Anti-eIF-2B GDP-GTP exchange factor subunit epsilon, Anti-Translation initiation factor eIF-2B... |
| Application: | WB |
| Host: | Rabbit |
| Species reactivity: | human |
From 206.00€
*
EIF2B5 (human), recombinant protein
Item number: ABS-PP-6524-L.100
Protein function: Catalyzes the exchange of eukaryotic initiation factor 2- bound GDP for GTP. [The UniProt Consortium]
| Keywords: | Translation initiation factor eIF-2B subunit epsilon, eIF-2B GDP-GTP exchange factor subunit epsilon, Recombinant Human... |
| Expressed in: | E.coli |
| Origin: | human |
| MW: | 41.5 kD |
From 115.00€
*