4 products were found matching "96702-03-3"!
No results were found for the filter!
Ectoine
Item number: AG-CN2-0390-G001
White solid. Soluble in water (560mg/ml) or methanol (40mg/ml). Natural chemical product. CAS: 96702-03-3. Formula: C6H10N2O2. MW: 142.2. Isolated from halophilic bacteria Halomonas elongata. The ectoines belong to the class of compatible solutes also called extremolytes (osmolytes from extremophiles). Extremolytes...
| Keywords: | Ectoin, (S)-2-Methyl-4-carboxyl-1,4,5,6-tetrahydropyridine, Pyrostatine B |
| CAS | 96702-03-3 |
| MW: | 142,2 D |
From 37.00€
*
Ectoine (ultrapure)
Item number: AG-CN2-0391-G001
White solid. Soluble in water (560mg/ml) or methanol (40mg/ml). Natural chemical product. CAS: 96702-03-3. Formula: C6H10N2O2. MW: 142.2. Isolated from halophilic bacteria Halomonas elongata. The ectoines belong to the class of compatible solutes also called extremolytes (osmolytes from extremophiles). Extremolytes...
| Keywords: | Ectoin, (S)-2-Methyl-4-carboxyl-1,4,5,6-tetrahydropyridine, Pyrostatine B |
| CAS | 96702-03-3 |
| MW: | 142,2 D |
From 158.00€
*
Ectoine
Item number: Cay31167-10
Ectoine is a microbial metabolite that has been found in extremophilic bacteria and has photoprotectant and anti-inflammatory activities. It is biosynthesized in bacteria that grow in extreme conditions, such as high temperatures, intensive sun irradiation, and drought, to protect macromolecules against...
| Keywords: | Ectoin, NSC 614616, Pyrostatin B, (4S)-3,4,5,6-tetrahydro-2-methyl-4-pyrimidinecarboxylic acid |
| Application: | Microbial metabolite, photoprotectant, antiinflammatory, macromolecule stabilization |
| CAS | 96702-03-3 |
| MW: | 142.2 D |
From 173.00€
*
Ectoine
Item number: TGM-T4038-100mg
Description: Ectoine (L-Ectoine) is an osmoprotectant in a variety of microorganisms including halophilic and heterotrophic bacteria and non-halophilic bacteria such as the Streptomyces species, as well as E.coli. Target: Antibacterial, Others. Smiles: C(O)(=O)[C@H]1NC(C)=NCC1. References: Meyer S., et al. Ectoine...
| Keywords: | THP(B), L-Ectoine |
| CAS | 96702-03-3 |
| MW: | 142.16 D |
43.00€
*
