Description: Tripeptide-10 Citrulline (T10-C) is a bioactive peptide recognized for its anti-aging properties and has been documented as an ingredient in cosmetics [1]. Smiles: [C@@H](NC([C@@H](NC([C@H](CCCCN)N)=O)CC(O)=O)=O)(C(N[C@@H](CCCNC(N)=O)C(N)=O)=O)[C@H](CC)C

Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...