Description: Myristoyl Tetrapeptide-12 activates SMAD2 and facilitates the association of SMAD3 with DNA, promoting eyelash hair growth [1] [2]. Target: TGF-beta/Smad. Smiles: CCCCCCCCCC CCCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(N)=O

Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...