2 products were found matching "949004-12-0"!
No results were found for the filter!
(25S)-Delta7-Dafachronic Acid
Item number: Cay14101-100
During unfavorable environmental conditions, C. elegans larvae undergo arrest and form dauer larvae that can attach to other animals as a parasitic strategy for survival. DAF-12 is an orphan nuclear hormone receptor that regulates dauer larva diapause, reproductive development, fat metabolism, and life...
| Keywords: | UPF-1404, (5alpha,25S)-3-oxo-cholest-7-en-26-oic acid |
| Application: | DAF-12 inhibitor |
| CAS | 949004-12-0 |
| MW: | 414.6 D |
From 429.00€
*
(25S)-delta7-Dafachronic acid
Item number: TGM-T26370-1mg
Description: (25S)-delta7-Dafachronic acid, an orphan nuclear receptor DAF-12 ligand, inhibits the dauer-promoting activity of DAF-12. Target: Others. Smiles: C[C@@]12[C@](C=3[C@@]([C@]4(C)[C@@](CC3)(CC(=O)CC4)[H])(CC1)[H])(CC[C@@]2([C@@H](CCC[C@@H](C(O)=O)C)C)[H])[H]. References: Martin R, Däbritz F, Entchev EV,...
| CAS | 949004-12-0 |
| MW: | 414.62 D |
From 934.00€
*
