3 products were found matching "94497-51-5"!
No results were found for the filter!
Tamibarotene
Item number: TGM-T6694-100mg
Description: Tamibarotene (Amnolake) is an orally active, synthetic retinoid, developed to overcome all-trans retinoic acid (ATRA) resistance, with potential antineoplastic activity. Target: Autophagy, Apoptosis, Retinoid Receptor. Smiles: CC1(C)C=2C(=CC(NC(=O)C3=CC=C(C(O)=O)C=C3)=CC2)C(C)(C)CC1. References: Sanda...
| Keywords: | Am 80, Amnolake, NSC 608000 |
| Application: | Targets retinoic acid receptor alpha (RARA, NR1B1) |
| CAS | 94497-51-5 |
| MW: | 351.44 D |
From 40.00€
*
AM80
Item number: Cay71770-5
AM80 is a retinoic acid receptor agonist that is selective for RARalpha (Kd = 62 nM, AC50 = 1.46 nM) compared to RARbeta (Kd = 280 nM, AC50 = 6.87 nM) and RARgamma (Kd = 816 nM, AC50 = 148.7 nM). It demonstrates greater specific binding to RARalpha compared to retinoic acid (Cay-11017), which exhibits little...
| Keywords: | Amnolake, NSC 608000, Retinobenzoic Acid, Tamibarotene,... |
| Application: | Retinoic acid receptor alpha agonist |
| CAS | 94497-51-5 |
| MW: | 351.4 D |
From 111.00€
*
Tamibarotene
Item number: LKT-T0249.10
RARalpha/beta agonist.
| Keywords: | Am80, Retinobenzoic acid, AM-80, 4-((5,5,8,8-Tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)carbamoyl)benzoic acid |
| Application: | Antineoplastic |
| CAS | 94497-51-5 |
From 153.00€
*
