4 products were found matching "91809-67-5"!
No results were found for the filter!
6-TAMRA
Item number: TGM-T18905-10mg
Description: 6-TAMRA (6-Carboxytetramethylrhodamine) serves as a popular fluorophore for the creation of bioconjugates, particularly in the synthesis of fluorescent antibodies and avidin derivatives employed in immunochemistry. Target: Others. Smiles: CN(C)c1ccc2c(-c3cc(ccc3C([O-])=O)C(O)=O)c3ccc(cc3[o+]c2c1)N(C)C
| Keywords: | 6-Carboxytetramethylrhodamine |
| CAS | 91809-67-5 |
| MW: | 430.45 D |
From 42.00€
*
6-TAMRA (6-Carboxytetramethylrhodamine) *Validated for...
Item number: ABD-366
6-TAMRA is the purified single isomer of 5(6)-TAMRA. Minor positional difference between 5-TAMRA and 6-TAMRA might affect some biological properties of the underlying conjugates.
| Application: | Labeling |
| CAS | 91809-67-5 |
From 110.00€
*
6-TAMRA
Item number: CDX-C0056-M025
Free acid form of 6-carboxytetramethylrhodamine single isomer. The corresponding succinimidyl ester is a single isomer fluorophore most commonly used in automated DNA sequencing.
| Keywords: | 6-Carboxytetramethylrhodamine |
| Application: | Fluorescent dye |
| CAS | 91809-67-5 |
| MW: | 430,45 D |
From 240.00€
*
6-Carboxytetramethylrhodamine
Item number: Cay29046-1
6-Carboxytetramethylrhodamine is a fluorescent dye that has commonly been used for the covalent labeling of oligonucleotides for DNA analysis. It displays excitation/emission maxima of 543/572 nm, respectively. 6-Carboxytetramethylrhodamine has been used in various DNA-protein binding studies, DNA FRET experiments,...
| Keywords: | 6-TAMRA, 9-(2,5-dicarboxyphenyl)-3,6-bis(dimethylamino)-xanthylium, inner salt |
| Application: | Fluorescent dye, DNA oligonucleotide labeling |
| CAS | 91809-67-5 |
| MW: | 430.5 D |
From 44.00€
*
