CCK (26-31) is an N-terminal fragment of CCK (Cay-23371, Cay-24404), a peptide hormone found in the intestine and brain that stimulates digestion, mediates satiety, and is involved in anxiety.Formal Name: N-acetyl-L-alpha-aspartyl-L-tyrosyl-L-methionylglycyl-L-tryptophyl-L-methioninamide. CAS Number: 89911-64-8....

Description: CCK (26-31) is an N-terminal fragment of CCK , a peptide hormone found in the intestine and brain that stimulates digestion, mediates satiety, and is involved in anxiety. Smiles: CSCC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)[C@H](CCSC)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(O)=O)NC(C)=O)C(N)=O