Description: Biotin-LC-LC-NHS, an SMCC cross-linking reagent, acts as a labeling agent for antibodies and small molecules (like Paclitaxel). Target: Others. Smiles: C(CCCC(NCCCCCC(NCCCCCC(ON1C(=O)CCC1=O)=O)=O)=O)[C@H]2[C@@]3([C@](CS2)(NC(=O)N3)[H])[H]. References: K Dill, et al. Immunoassays Based on Electrochemical...

Biotin-LC-LC-NHS is a biotinylation reagent that contains an N-hydroxysuccinimide (NHS) moiety, which activates carboxylic acid groups on biotin to facilitate coupling reactions, and a 30.5 Å spacer to decrease steric hindrance. It has been used to biotinylate small molecules such as paclitaxel (Cay-10461) and...