2 products were found matching "890190-22-4"!
No results were found for the filter!
WDR5-0103
Item number: Cay13945-1
WD-repeat protein 5 (WDR5) is a scaffold protein commonly involved in the formation of nucleosome-modifying protein complexes with histones. For example, WDR5 is a component of a mixed-lineage leukemia (MLL) methyltransferase complex that targets histone 3. WDR5 can also be a component of histone acetyltransferase...
| Keywords: | WD-Repeat Protein 5-0103, 3-[(3-methoxybenzoyl)amino]-4-(4-methyl-1-piperazinyl)-benzoic acid, methyl ester |
| Application: | MLL core complex inhibitor |
| CAS | 890190-22-4 |
| MW: | 383.4 D |
From 38.00€
*
WDR5-0103
Item number: TGM-T3201-100mg
Description: WDR5-0103 (WD-Repeat Protein 5-0103) is an effective and specific WD repeat-containing protein 5 (WDR5) antagonist (Kd: 450 nM). Target: JAK, Histone Methyltransferase. Smiles: COC(=O)c1ccc(N2CCN(C)CC2)c(NC(=O)c2cccc(OC)c2)c1
| Keywords: | WD-Repeat Protein 5-0103 |
| Application: | MLL core complex inhibitor |
| CAS | 890190-22-4 |
| MW: | 383.44 D |
From 37.00€
*
