Description: Fmoc-NH-PEG2-CH2CH2COOH is a cleavable ADC linker utilized in the synthesis of antibody-drug conjugates (ADCs)[1]. Target: Others, ADC Linker. Smiles: OC(=O)CCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc12. References: Fulcher JM, et al. Chemical synthesis of Shiga toxin subunit B using a next-generation traceless...

Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...