Description: Tetrapeptide-3 is a bioactive chemical. Smiles: [C@H](CC1=CN=CN1)(C(N[C@@H](CCCCN)C(N)=O)=O)NC(CNC([C@H](CCCCN)N)=O)=O. References: Zhang S, Qiu Y, Gao Y. Enhanced delivery of hydrophilic peptides in vitro by transdermal microneedle pretreatment. Acta Pharm Sin B. 2014 Feb,4(1):100-4. doi:...

Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...