Description: Boc-D-2-Nal-OH is a useful organic compound for research related to life sciences. The catalog number is T66189 and the CAS number is 76985-10-9. Smiles: CC(C)(C)OC(=O)N[C@H](Cc1ccc2ccccc2c1)C(O)=O

Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...