3 products were found matching "6956-96-3"!
No results were found for the filter!
DMNQ
Item number: TGM-T5426-100mg
Description: DMNQ is a 1,4-naphthoquinone that acts as a redox-cycling agent, typically increasing intracellular superoxide and hydrogen peroxide formation.DMNQ increases ROS generation. Target: Reactive Oxygen Species, ROS. Smiles: COC1=C(OC)C(=O)c2ccccc2C1=O. References: The Bioenergetic Health Index is a...
| CAS | 6956-96-3 |
| MW: | 218.21 D |
From 60.00€
*
DMNQ
Item number: Cay19571-5
DMNQ is a 1,4-naphthoquinone that acts as a redox-cycling agent, typically increasing intracellular superoxide and hydrogen peroxide formation. The amount of oxidative stress is proportional to the amount of DMNQ applied and can alter diverse cellular parameters, including signal transduction, mitochondrial...
| Keywords: | NSC 69355, 2,3-dimethoxy-1,4-naphthalenedione |
| Application: | Redox-cycling agent, increasing intracellular superoxide and hydrogen peroxide formation |
| CAS | 6956-96-3 |
| MW: | 218.2 D |
From 107.00€
*
DMNQ
Item number: CDX-D0205-M010
Yellow powder. Soluble in DMSO or methanol. A cell-permeable, non-alkylating, non-thiol, adduct-forming, redox cycling quinone. Generates superoxide production and induces cell proliferation, apoptosis and necrosis in vitro. Redox cycling agent.
| Keywords: | 2,3-Dimethoxy-1,4-naphthoquinone |
| Application: | Redox cycling agent |
| CAS | 6956-96-3 |
| MW: | 218,21 D |
From 183.00€
*
