Description: Trifluoroacetyl tripeptide-2, a bioactive peptide recognized for its anti-aging properties, is utilized as a cosmetic ingredient [1]. Smiles: [C@@H](CC1=CC=C(O)C=C1)(NC([C@@H](NC(C(F)(F)F)=O)[C@@H](C)C)=O)C(N[C@@H]([C@H](C)C)C(O)=O)=O

Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...