Description: Lissamine rhodamine B sulfonyl chloride is a fluorescent label used for forming stable conjugates with protein. Target: Others. Smiles: O=S(=O)([O-])C=1C=C(C=CC1C=2C=3C=CC(=CC3[O+]=C4C=C(C=CC42)N(CC)CC)N(CC)CC)S(=O)(=O)Cl. References: Lefevre C, Kang HC, Haugland RP, Malekzadeh N, Arttamangkul S,...

SRB sulfonyl chloride is highly fluorescent. It reacts with amine compounds such as amino acids, peptides and proteins to give bright red fluorescent conjugates that are extremely stable, and resistant to protease-catalyzed hydrolysis.