3 products were found matching "565460-15-3"!
No results were found for the filter!
URB602
Item number: Cay10007457-10
URB602 is a selective inhibitor of monoacylglycerol lipase (MAGL), exhibiting an IC50 value of 28 µM for the rat brain enzyme. It does not inhibit fatty acid amide hydrolase (FAAH) at concentrations up to 100 µM or other lipid metabolizing enzymes such as diacylglycerol lipase or COX-2. Inhibition of MAGL inhibits...
| Keywords: | N-[1,1'-biphenyl]-3-yl-carbamic acid, cyclohexyl ester |
| Application: | Selective monoglyceride lipase (MGL) inhibitor |
| CAS | 565460-15-3 |
| MW: | 295.4 D |
From 57.00€
*
URB602
Item number: LKT-U682042.100
Inhibitor of Monoacyglycerol lipase (MAGL).
| Keywords: | [1,1'-Biphenyl]-3-yl-carbamic acid cyclohexyl ester |
| Application: | Selective monoglyceride lipase (MGL) inhibitor |
| CAS | 565460-15-3 |
| MW: | 295.38 D |
From 79.00€
*
URB602
Item number: TGM-T3591-100mg
Description: URB602 is a specific monoacylglycerol lipase (MGL) inhibitor, which inhibits rat brain MGL (IC50: 28±4 µM) through a noncompetitive mechanism. Target: Lipase, Antibacterial. Smiles: O=C(Nc1cccc(c1)-c1ccccc1)OC1CCCCC1
| Application: | Selective monoglyceride lipase (MGL) inhibitor |
| CAS | 565460-15-3 |
| MW: | 295.38 D |
From 29.00€
*
