Description: Muscarine is a toxic alkaloid found in Amanita muscaria and other fungi of the Inocybe species. Target: Others. Smiles: C([N+](C)(C)C)[C@@H]1C[C@@H](O)[C@H](C)O1. References: Zhu Y, Dewell RB, Wang H, Gabbiani F. Pre-synaptic Muscarinic Excitation Enhances the Discrimination of Looming Stimuli in a...

Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...