Biotin tripeptide-1 is an extracellular matrix (ECM) peptide that has been conjugated to biotin (Cay-22582). It stimulates the production of collagen IV and laminin in dermal and epidermal cells ex vivo. Biotin tripeptide-1 localizes to the peri-pilial zone of isolated cultured human hair follicles, induces...

Description: Biotinoyl tripeptide-1 can produce hair follicles by promoting scalp micro-circulation and reduce follicle atrophy and aging. Smiles: C(CCCC(NCC(N[C@@H](CC1=CN=CN1)C(N[C@@H](CCCCN)C(O)=O)=O)=O)=O)[C@H]2[C@@]3([C@](CS2)(NC(=O)N3)[H])[H]. References: Lee CK, Cheong C, Jeon YH. Substrate recognition...

Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...