Description: Treosulfan (Treosulphan) is a bifunctional alkylating agent. It also has activity in ovarian cancer and other solid tumor types. Target: DNA Alkylation, DNA Alkylator/Crosslinker. Smiles: CS(=O)(=O)OC[C@H](O)[C@@H](O)COS(C)(=O)=O. References: Nitsch E, et al. Synergistic cytotoxic activity of...

Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...