Description: (E/Z)-IT-603 is a cell-permeable c-Rel inhibitor (IC50: 3µM) that directly and reversibly binds to c-Rel, altering its conformation and inhibiting its DNA binding and transcriptional activity. Target: NF-kappaB, Others. Smiles: COc1cc(Br)cc(\C=C2\NC(=S)NC2=O)c1O. References: Shono Y , Tuckett A Z , Ouk...

(E/Z)-IT-603 is a c-Rel inhibitor (IC50 = 3 µM). It inhibits c-Rel DNA binding to the IL2 promoter in an EMSA. (E/Z)-IT-603 reduces the proliferation of OCI-Ly3 diffuse large B cell lymphoma cells (IC50 = 18 µM). It reduces Huh7 epithelial carcinoma spheroid growth when used at a concentration of 20 µM in...