3 products were found matching "2869954-34-5"!
No results were found for the filter!
HRO761
Item number: TGM-T72107-100mg
Description: HRO761 is a potent Werne r syndrome RecQ DNA deconjugase (WRN) inhibitor that can be used to study cancers such as colon and stomach cancer. Target: DNA/RNA Synthesis. Smiles: C(C(NC1=C(Cl)C=C(C(F)(F)F)C=C1)=O)N2C=3N(C(=O)C(=C2CC)N4CCN(C(=O)C=5C(O)=C(C)N=CN5)CC4)N=C(N3)C=6CCOCC6. References:...
| Keywords: | HRO-761 , Werner syndrome RecQ helicase-IN-1 |
| CAS | 2869954-34-5 |
| MW: | 702.08 D |
From 52.00€
*
Werner Syndrome RecQ Helicase-IN-1
Item number: Cay41596-10
Werner syndrome RecQ helicase-IN-1 is an inhibitor of the DNA helicase Werner syndrome protein (WRN, IC50 = 100 nM in an enzyme activity assay). It selectively inhibits WRN over the DNA helicases Bloom syndrome protein (BLM), RecQ1, and RecQ5 (IC50s = >100 µM for all in enzyme activity assays) and the growth of...
| Keywords: | WS RecQ Helicase Inhibitor 1, HRO761, Werner Syndrome RecQ Helicase Inhibitor 1, WS RecQ Helicase-IN-1,... |
| Application: | WRN inhibitor |
| CAS | 2869954-34-5 |
| MW: | 702.1 D |
From 147.00€
*
HRO761
Item number: BPS-82691-2
HRO761 (Werner syndrome RecQ helicase-IN-1) is a potent Werner syndrome RecQ DNA helicase enzyme (WRN) inhibitor and can be used in cancer research1.
| Keywords: | HRO761, WRN inhibitor, Werner syndrome RecQ helicase-IN-1, |
| Application: | DNA damage/repair/cancer therapy target studies |
| CAS | 2869954-34-5 |
| MW: | 702,08 D |
From 848.00€
*
