Description: N-Valyltryptophan (Val-trp) is an incomplete breakdown product of protein catabolism or protein digestion. Target: Others. Smiles: CC(C)[C@H](N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(O)=O. References: Li Y, Wang F, Zhang PZ, Yang M. [Chemical Constituents from Periplaneta americana]. Zhong Yao Cai. 2015...

Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...