2 products were found matching "2438-80-4"!
No results were found for the filter!
(-)-Fucose
Item number: TGM-TJO2691-100mg
Description: 1.(-)-Fucose (6-Desoxygalactose) can anti-infective, anti-cancer, enhance immunity 2. (-)-Fucose is a skin moisturizing and delaying skin aging 3. (-)-Fucose is a nutritional supplement. Target: Endogenous Metabolite, Parasite. Smiles: [C@@H]([C@@H]([C@H](C)O)O)([C@@H](C=O)O)O. References: Becker DJ,...
| Keywords: | Madecassic acid, L-(-)-Fucose, Brahmic acid, 6-Desoxygalactose, L-Galactomethylose |
| Application: | Supplement (fucose) |
| CAS | 2438-80-4 |
| MW: | 164.16 D |
From 31.00€
*
L-(-)-Fucose
Item number: Cay16479-10
L-(-)-Fucose is a deoxyhexose monosaccharide found on N- and O-linked glycans and glycolipids of a wide variety of organisms. It can exist as a terminal modification of glycan structures or serve as a point of attachment for adding other sugars. In humans, L-(-)-fucose plays a role in A and B blood group antigen...
| Keywords: | 6-deoxy-L-Galactose, 6-deoxy-L-galactose |
| Application: | Glycan / glycolipid component |
| CAS | 2438-80-4 |
| MW: | 164.2 D |
From 52.00€
*
