3 products were found matching "2139287-33-3"!
No results were found for the filter!
THAL-SNS-032
Item number: TGM-T17069-100mg
Description: THAL-SNS-032 is a PROTAC designed to selectively degrade CDK9. Target: CDK, PROTACs. Smiles: O=C1C=2C(C(=O)N1C3C(=O)NC(=O)CC3)=CC=CC2NCCOCCOCCO CCNC(CN4CCC(C(NC=5SC(SCC=6OC(C(C)(C)C)=CN6)=CN5)=O)CC4)=O
| Application: | Protac(R) reagent |
| CAS | 2139287-33-3 |
| MW: | 869.02 D |
From 117.00€
*
THAL-SNS-032
Item number: Cay40958-10
THAL-SNS-032 is a proteolysis-targeting chimera (PROTAC) containing the cyclin-dependent kinase 2 (Cdk2), Cdk7, and Cdk9 inhibitor SNS-032 (Cay-17904) linked to a cereblon (CRBN) binding moiety. It selectively induces degradation of Cdk9 over Cdk1, Cdk2, and Cdk7 in MOLT-4 cells when used at a concentration of 250...
| Keywords: | 4-[[[5-[[[5-(1,1-dimethylethyl)-2-oxazolyl]methyl]thio]-2-thiazolyl]amino]carbonyl]-N-[2-[2-[2-[2-[[2-(2,6-dioxo-3-piperid... |
| Application: | Cdk9 degradation driving PROTAC |
| CAS | 2139287-33-3 |
| MW: | 869 D |
From 478.00€
*
THAL-SNS-032
Item number: BPS-82038
THAL-SNS-032 is a selective CDK9 degrader PROTAC composed of a CDK-binding SNS-032 ligand linked to a thalidomide derivative that binds the E3 ubiquitin ligase Cereblon (CRBN).
| Application: | Protac(R) reagent |
| CAS | 2139287-33-3 |
| MW: | 869,0 D |
1,615.00€
*
